:Piericidin A

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 432339591

| Name =

| ImageFile = Piericidin A.svg

| ImageSize = 250px

| PIN = 2-[(2E,5E,7E,9R,10R,11E)-10-Hydroxy-3,7,9,11-tetramethyltrideca-2,5,7,11-tetraen-1-yl]-5,6-dimethoxy-3-methylpyridin-4(1H)-one

| OtherNames = Piericidin A1, AR-054

| SystematicName =

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=2738-64-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8VT513UJ9R

| PubChem=6437838

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 138511

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4942360

| SMILES = C/C=C(\C)/[C@@H]([C@H](C)/C=C(\C)/C=C/C/C(=C/Cc1c(c(=O)c(c([nH]1)OC)OC)C)/C)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C25H37NO4/c1-9-18(4)22(27)19(5)15-17(3)12-10-11-16(2)13-14-21-20(6)23(28)24(29-7)25(26-21)30-8/h9-10,12-13,15,19,22,27H,11,14H2,1-8H3,(H,26,28)/b12-10+,16-13+,17-15+,18-9+/t19-,22+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BBLGCDSLCDDALX-LKGBESRRSA-N

| MeSHName=Piericidin+A

}}

| Section2 = {{Chembox Properties

| C=25 | H=37 | N=1 | O=4

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

| Section3 = {{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

| Section4 =

| Section5 =

| Section6 =

}}

Piericidin A is an antibiotic agent.{{Cite web|url=https://meshb.nlm.nih.gov/record/ui?name=Piericidin%20A|title=MeSH Record of Piericidin A|website=U.S. National Library of Medicine, NIH|access-date=2018-05-22}} It was discovered from Streptomyces mobaraensis. Being an inhibitor of NADH dehydrogenase, it inhibits electron transfer; its structure resembles that of the ubiquinone, therefore it competes with QB for binding sites in NADH dehydrogenase as well as photosystem II.

References