:Pigment yellow 139

{{Chembox

| ImageFile =PY139.svg

| ImageSize = 140px

| ImageAlt =

| PIN = 5,5′-(1H-Isoindole-1,3(2H)-diylidene)di(1,3-diazinane-2,4,6-trione)

| OtherNames = Lithol, Fast Yellow 1840

|Section1={{Chembox Identifiers

| CASNo = 36888-99-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZW25289FVV

| EINECS = 253-256-2

| PubChem = 5488898

| ChemSpiderID = 4590022

| SMILES = O=C1NC(=O)NC(=O)C1=C2c3ccccc3C(N2)=C4C(=O)NC(=O)NC4=O

| StdInChI = 1S/C16H9N5O6/c22-11-7(12(23)19-15(26)18-11)9-5-3-1-2-4-6(5)10(17-9)8-13(24)20-16(27)21-14(8)25/h1-4,17H,(H2,18,19,22,23,26)(H2,20,21,24,25,27)

| StdInChIKey = JSBMGPVJAADXIZ-UHFFFAOYSA-N }}

|Section2={{Chembox Properties

| Formula = C₁₆H₉N₅O₆

| MolarMass =

| Appearance = orange solid

| Density = 1.742 g/cm³

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Pigment yellow 139 is an organic compound that is used as a yellow-orange pigment. It is classified as a derivative of isoindoline. This yellow-orange solid is virtually insoluble in most solvents.K. Hunger. W. Herbst "Pigments, Organic" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2012. {{doi|10.1002/14356007.a20_371}}

It is prepared by addition of ammonia to phthalonitrile to give diiminoisoindole, which in turn condenses with barbituric acid.Volker Radtke, Peter Erk andBenno Sens "Isoindoline Pigments" in Edwin B. Faulkner, Russell J. Schwartz in High Performance Pigments. Edited by Edwin B. Faulkner and Russell J. Schwartz, Wiley-VCH, Weinheim. 2009. {{doi| 10.1002/9783527626915.ch14}}