:PipISB

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-(4-fluorobenzyl)-4-(3-(piperidin-1-ylindole-1-sulfonyl)benzamide

| image = PipISB Structure.svg

| width = 175

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 859165-19-8

| ATC_prefix =

| ATC_suffix =

| PubChem = 58975213

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 65322455

| chemical_formula =

| C=27 | H=26 | F=1 | N=3 | O=3 | S=1

| StdInChI=1S/C27H26FN3O3S/c28-22-12-8-20(9-13-22)18-29-27(32)21-10-14-23(15-11-21)35(33,34)31-19-26(30-16-4-1-5-17-30)24-6-2-3-7-25(24)31/h2-3,6-15,19H,1,4-5,16-18H2,(H,29,32)

| StdInChIKey = RXTQWWFLLRSBCM-UHFFFAOYSA-N

| smiles = O=S(N1C2=CC=CC=C2C(N3CCCCC3)=C1)(C4=CC=C(C(NCC5=CC=C(F)C=C5)=O)C=C4)=O

}}

PipISB is a drug used in scientific research which acts as a potent and selective inverse agonist of the cannabinoid receptor CB₁. It is highly selective for the CB₁ receptor over CB₂, with a K_d at CB₁ of 1.5 nM vs over 7000 nM at CB₂, has good blood–brain barrier penetration, and can be conveniently radiolabelled with either ¹¹C or ¹⁸F, making it useful for mapping the distribution of CB₁ receptors in the brain.{{cite journal | vauthors = Donohue SR, Halldin C, Schou M, Hong J, Phebus L, Chernet E, Hitchcock SA, Gardinier KM, Ruley KM, Krushinski JH, Schaus J | display-authors = 6 | title = Radiolabeling of a high potency cannabinoid subtype-1 receptor inverse agonist, N-(4-fluoro-benzyl)-4-(3-(piperidin-1-yl-indole-1-sulfonyl)benzamide (PipISB), with carbon-11 or fluorine-18 | journal = Journal of Labelled Compounds and Radiopharmaceuticals | volume = 51| issue = 3 | pages = 146 | doi =10.1002/jlcr.1491 | year = 2008 }}{{cite journal | vauthors = Finnema SJ, Donohue SR, Zoghbi SS, Brown AK, Gulyás B, Innis RB, Halldin C, Pike VW | display-authors = 6 | title = Evaluation of [11C]PipISB and [18F]PipISB in monkey as candidate radioligands for imaging brain cannabinoid type-1 receptors in vivo | journal = Synapse | volume = 63 | issue = 1 | pages = 22–30 | date = January 2009 | pmid = 18925657 | pmc = 2587077 | doi = 10.1002/syn.20578 }}