:Procyanidin B4

{{chembox

| Watchedfields = changed

| verifiedrevid = 318433201

| Name = Procyanidin B4

| Reference =

| ImageFile = Procyanidin B4.svg

| ImageName = Chemical structure of procyanidin B

| ImageSize = 200px

| IUPACName = [(2R,3S,4S)-Flavan-3,3′,4′,5,7-pentol]-(4→8)-[(2R,3R)-flavan-3,3′,4′,5,7-pentol]

| SystematicName = (2R,2′R,3S,3′R,4S)-2,2′-Bis(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro-2H,2′H-[4,8′-bi-1-benzopyran]-3,3′,5,5′,7,7′-hexol

| OtherNames = Procyanidin B4

|Section1={{Chembox Identifiers

| CASNo = 29106-51-2

| CASNoOther =

| PubChem = 147299

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 27589

| KEGG = C10238

| UNII = 2OP8987K2X

| ChEMBL = 447373

| ChemSpiderID = 129882

| SMILES = O[C@@H]1Cc2c(O)cc(O)c([C@H]3[C@H](O)[C@H](Oc4cc(O)cc(O)c34)c3ccc(O)c(O)c3)c2O[C@@H]1c1ccc(O)c(O)c1

| StdInChI = 1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28-,29-/m1/s1

| StdInChIKey = XFZJEEAOWLFHDH-VUGKQVTMSA-N

}}

|Section2={{Chembox Properties

| Formula = C30H26O12

| MolarMass = 578.52 g/mol

| Appearance=

| Density=

| MeltingPtC=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Procyanidin B4 is a B type proanthocyanidin.

Procyanidin-B4 is a catechin-(4α→8)-epicatechin dimer. It is found in the litchi pericarp,[http://cat.inist.fr/?aModele=afficheN&cpsidt=18403041 Immunomodulatory and anticancer activities of flavonoids extracted from litchi (Litchi chinensis Sonn.) pericarp. Mouming Zhao; Bao Yang; Jinshui Wang; Yang Liu; Limei Yu; Yueming Jiang, 2007] in grape seeds,{{cite journal | url=https://www.sciencedirect.com/science/article/abs/pii/S0014299908006705 | doi=10.1016/j.ejphar.2008.06.068 | title=Catechin and proanthocyanidin B4 from grape seeds prevent doxorubicin-induced toxicity in cardiomyocytes | journal=European Journal of Pharmacology | date=4 September 2008 | volume=591 | issue=1 | pages=96–101 | last1=Du | first1=Yu | last2=Lou | first2=Hongxiang | pmid=18611398 | url-access=subscription }} and, along with 4-cis-isomer of procyanidin B4, in beer.[http://www.agr.kuleuven.ac.be/lmt/labolmc/DOCS/Delcour.htm Structure elucidation of proanthocyanidins: Direct synthesis and isolation from Pilsener beer. Jan Delcour, 1985] {{webarchive|url=https://web.archive.org/web/20110706132451/http://www.agr.kuleuven.ac.be/lmt/labolmc/DOCS/Delcour.htm |date=2011-07-06 }}

See also

References

{{reflist}}

{{procyanidin}}

Category:Procyanidin dimers

{{Aromatic-stub}}