:Punicacortein B

{{Chembox

| Verifiedfields =

| verifiedrevid =

| Name = Punicacortein B

| ImageFile = Punicacortein B.PNG

| ImageSize = 228px

| ImageName = Chemical structure of punicacortein B

| IUPACName = (2R,3R)-3-[(14S,15S,19S)-2,3,4,7,8,9,19-Heptahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.0^5,18.0^6,11]nonadeca-1(18),2,4,6,8,10-hexaen-14-yl]-2,3-dihydroxypropyl 3,4,5-trihydroxybenzoate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 103488-36-4

| CASNo_Ref = {{Cascite|changed|CAS}}

| PubChem = 20056239

| ChEMBL_Ref =

| ChEMBL =

| ChemSpiderID = 16738326

| SMILES = Oc1cc(cc(O)c1O)C(=O)OC[C@@H](O)[C@@H](O)[C@@H]5OC(=O)c2cc(O)c(O)c(O)c2c3c(O)c(O)c(O)c4[C@H](O)[C@@H]5OC(=O)c34

| InChIKey = 1S/C27H22O18/c28-7-1-5(2-8(29)15(7)32)25(40)43-4-10(31)17(34)23-24-21(38)14-13(27(42)45-24)12(19(36)22(39)20(14)37)11-6(26(41)44-23)3-9(30)16(33)18(11)35/h1-3,10,17,21,23-24,28-39H,4H2/t10-,17-,21+,23+,24+/m1/s1

| InChIKey2 = JYPJJOONMBTTAR-MEZSAOBOSA-N

}}

|Section2={{Chembox Properties

| Formula = C₂₇H₂₂O₁₈

| MolarMass = 634.43 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Punicacortein B is an ellagitannin, a polyphenol compound. It is found in the bark of Punica granatum (pomegranate).Tannins and Related Compounds. XLI. : Isolation and Characterization of Novel Ellagitannins, Punicacorteins A, B, C, and D, and Punigluconin from the Bark of Punica granatum L. Tanaka Takashi, Nonaka Gen-Ichiro and Nishioka Itsuo, Chemical & Pharmaceutical Bulletin, 1986-02-25, 34(2), pages 656-663 ([http://ci.nii.ac.jp/naid/110003626133/ abstract])