:Pyrinuron

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464377441

| ImageFile= Pyrinuron Structure.svg

| ImageSize=

| PIN= N-(4-Nitrophenyl)-N′-[(pyridin-3-yl)methyl]urea

| OtherNames=Pyriminil
Vacor

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 37276

| InChI = 1/C13H12N4O3/c18-13(15-9-10-2-1-7-14-8-10)16-11-3-5-12(6-4-11)17(19)20/h1-8H,9H2,(H2,15,16,18)

| InChIKey = CLKZWXHKFXZIMA-UHFFFAOYAA

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H12N4O3/c18-13(15-9-10-2-1-7-14-8-10)16-11-3-5-12(6-4-11)17(19)20/h1-8H,9H2,(H2,15,16,18)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CLKZWXHKFXZIMA-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=53558-25-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Q7BGS137YP

| PubChem=40813

| SMILES = [O-][N+](=O)c1ccc(cc1)NC(=O)NCc2cccnc2

}}

|Section2={{Chembox Properties

| C=13 | H=12 | N=4 | O=3

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=Toxic

| FlashPt=

| AutoignitionPt =

}}

}}

Pyrinuron (Pyriminil, Vacor) is a chemical compound formerly used as a rodenticide.{{ cite journal | author = Vogel, R. P. | title = Poisoning with Vacor Rodenticide | journal = Archives of Pathology and Laboratory Medicine | year = 1982 | volume = 106 | issue = 3 | pages = 153 | pmid = 6895844 }} Commercial distribution was voluntarily suspended in 1979 and it is not approved by the Environmental Protection Agency for use in the United States.{{cite web | url = http://hazmap.nlm.nih.gov/category-details?id=6918&table=copytblagents | title = Pyriminil | publisher = U.S. National Library of Medicine | access-date = 2013-11-04 | archive-url = https://web.archive.org/web/20130704005423/http://hazmap.nlm.nih.gov/category-details?id=6918&table=copytblagents | archive-date = 2013-07-04 | url-status = dead }} If it is ingested by humans in high doses, it may selectively destroy insulin-producing beta cells in the pancreas causing type 1 diabetes. The neurodegeneration associated with Vacor is caused by its conversion to Vacor-mononucleotide (VMN) by NAMPT and VMN's subsequent activation of the NADase SARM1.{{Cite journal|last=Loreto|first=Andrea|last2=Angeletti|first2=Carlo|last3=Gu|first3=Weixi|last4=Osborne|first4=Andrew|last5=Nieuwenhuis|first5=Bart|last6=Gilley|first6=Jonathan|last7=Arthur-Farraj|first7=Peter|last8=Merlini|first8=Elisa|last9=Amici|first9=Adolfo|last10=Luo|first10=Zhenyao|last11=Hartley-Tassell|first11=Lauren|date=2021-06-23|title=Potent activation of SARM1 by NMN analogue VMN underlies vacor neurotoxicity|url=https://www.biorxiv.org/content/10.1101/2020.09.18.304261v2|journal=bioRxiv|language=en|pages=2020.09.18.304261|doi=10.1101/2020.09.18.304261|doi-access=free}}

References