:Ro10-5824
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 449585803
| IUPAC_name = 2-methyl-5-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]pyrimidin-4-amine
| image = Ro10-5824 Structure.svg
| tradename =
| licence_EU =
| pregnancy_category =
| legal_UK =
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 189744-46-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8X35VUU4YY
| ATC_suffix =
| PubChem = 16759175
| ChEMBL = 1616116
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID = 14016802
| C=17 | H=20 | N=4
| smiles = c3ccccc3C(=CC2)CCN2Cc1cnc(C)nc1N
| StdInChI = 1S/C17H20N4/c1-13-19-11-16(17(18)20-13)12-21-9-7-15(8-10-21)14-5-3-2-4-6-14/h2-7,11H,8-10,12H2,1H3,(H2,18,19,20)
| StdInChIKey = KABDATZAOUSYES-UHFFFAOYSA-N
}}
Ro10-5824 is a drug which acts as a dopamine receptor partial agonist selective for the D4 subtype, and has nootropic effects in animal studies.{{cite journal |vauthors=Powell SB, Paulus MP, Hartman DS, Godel T, Geyer MA |title=RO-10-5824 is a selective dopamine D4 receptor agonist that increases novel object exploration in C57 mice |journal=Neuropharmacology |volume=44 |issue=4 |pages=473–81 |date=March 2003 |pmid=12646284 |doi= 10.1016/S0028-3908(02)00412-4|s2cid=16594644 }}{{cite journal |vauthors=Newman-Tancredi A, Heusler P, Martel JC, Ormière AM, Leduc N, Cussac D |title=Agonist and antagonist properties of antipsychotics at human dopamine D4.4 receptors: G-protein activation and K+ channel modulation in transfected cells |journal=The International Journal of Neuropsychopharmacology |volume=11 |issue=3 |pages=293–307 |date=May 2008 |pmid=17897483 |doi=10.1017/S1461145707008061 |doi-access= }}
References
{{reflist}}
{{Dopaminergics}}
Category:Drugs developed by Hoffmann-La Roche
{{nervous-system-drug-stub}}