:SCH-50911
{{cs1 config|name-list-style=vanc}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 464385256
| ImageFile =SCH-50911.svg
| ImageSize =
| PIN =2-[(2S)-5,5-Dimethylmorpholin-2-yl]acetic acid
| OtherNames =
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4470917
| InChI = 1/C8H15NO3/c1-8(2)5-12-6(4-9-8)3-7(10)11/h6,9H,3-5H2,1-2H3,(H,10,11)/t6-/m0/s1
| InChIKey = SEYCKMQSPUVYEF-LURJTMIEBV
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C8H15NO3/c1-8(2)5-12-6(4-9-8)3-7(10)11/h6,9H,3-5H2,1-2H3,(H,10,11)/t6-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SEYCKMQSPUVYEF-LURJTMIESA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo =160415-07-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q5MMG73452
| PubChem =5311429
| IUPHAR_ligand = 1075
| SMILES = O=C(O)C[C@@H]1OCC(NC1)(C)C
| MeSHName =SCH-50911
}}
|Section2={{Chembox Properties
| Formula =C8H15NO3
| MolarMass =173.21 g·mol−1
| Appearance =
| Density =
| MeltingPtC = 154.5 to 157
| MeltingPt_notes = (hydrochloride)
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
SCH-50911 is a selective GABAB antagonist.{{cite journal | vauthors = Blythin DJ, Kuo SC, Shue HJ, McPhail AT, Chapman RW, Kreutner W, Rizzo C, She HS, West R | display-authors = 6 | title = Substituted morpholine-2S-acetic acid derivatives: Sch 50911 and related compounds as novel GABAB antagonists. | journal = Bioorganic & Medicinal Chemistry Letters | date = July 1996 | volume = 6 | issue = 13 | pages = 1529–34 | doi = 10.1016/S0960-894X(96)00267-3 }} Its main applications are in pharmacology research.
SCH-50911 also acts as an anticonvulsant under normal conditions. SCH-50911 induces acute withdrawal syndrome in GHB-dependent rats, similar to the delirium tremens seen in human alcohol withdrawal, and can precipitate convulsions in GHB-dependent animals.{{cite journal | vauthors = Quang LS, Colombo G, Lobina C, Maccioni P, Orru A, Gessa GL, Maher TJ, Carai MA | display-authors = 6 | title = Evaluation for the withdrawal syndrome from gamma-hydroxybutyric acid (GHB), gamma-butyrolactone (GBL), and 1,4-butanediol (1,4-BD) in different rat lines | journal = Annals of the New York Academy of Sciences | volume = 1074 | pages = 545–58 | date = August 2006 | issue = 1 | pmid = 17105952 | doi = 10.1196/annals.1369.055 | bibcode = 2006NYASA1074..545Q | s2cid = 86383425 }}