:SCH-51866
{{Chembox
| ImageFile = SCH-51866.svg
| ImageAlt =
| IUPACName = (6aR,9aS)-5-Methyl-2-[4-(trifluoromethyl)benzyl]-5,6a,7,8,9,9a-hexahydrocyclopenta[4,5]imidazo[2,1-b]purin-4(3H)-one
| OtherNames =
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 5270
| CASNo = 167298-74-0
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = F8GU4PSP29
| PubChem = 15473392
| ChemSpiderID = 26377910
| SMILES = CN1C(=O)C2=C(N=C(N2)CC3=CC=C(C=C3)C(F)(F)F)N4C1=N[C@H]5[C@@H]4CCC5
| InChI=1S/C19H18F3N5O/c1-26-17(28)15-16(27-13-4-2-3-12(13)23-18(26)27)25-14(24-15)9-10-5-7-11(8-6-10)19(20,21)22/h5-8,12-13H,2-4,9H2,1H3,(H,24,25)/t12-,13+/m1/s1
| InChIKey= JOSMPBVYYKRYLG-OLZOCXBDSA-N
}}
| Section2 = {{Chembox Properties
| C=19 | H=18 | F=3 | N=5 | O=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
SCH-51866 is a phosphodiesterase inhibitor.{{cite journal | last1 = Lusche | first1 = DF | last2 = Kaneko | first2 = H | last3 = Malchow | first3 = D | title = cGMP-Phosphodiesterase Antagonists Inhibit Ca2+-Influx in Dictyostelium discoideum and Bovine Cyclic-Nucleotide-Gated-Channel | journal = European Journal of Pharmacology | date = 18 April 2005 | volume = 513 | issue = 1–2 | pages = 9–20 | doi = 10.1016/j.ejphar.2005.01.047 | pmid = 15878705}}{{cite journal | last1 = Beaumont | first1 = V | last2 = Park | first2 = L | last3 = Rassoulpour | first3 = A | last4 = Dijkman | first4 = U | last5 = Heikkinen | first5 = T | last6 = Lehtimaki | first6 = K | last7 = Kontkanen | first7 = O | last8 = Al Nackkash | first8 = R | last9 = Bates | first9 = GP | last10 = Gleyzes | first10 = M | last11 = Steidl | first11 = E | last12 = Ramboz | first12 = S | last13 = Murphy | first13 = C | last14 = Beconi | first14 = MG | last15 = Dominguez | first15 = C | last16 = Munoz-Sanjuan | first16 = I | title = The PDE1/5 Inhibitor SCH-51866 Does Not Modify Disease Progression in the R6/2 Mouse Model of Huntington's Disease | journal = PLOS Currents | date = 13 February 2014 | volume = 6 | doi = 10.1371/currents.hd.3304e87e460b4bb0dc519a29f4deccca | pmid = 24558637 | pmc = 3923778 | doi-access = free }}
References
{{reflist}}
{{Phosphodiesterase inhibitors}}
Category:Phosphodiesterase inhibitors
Category:Trifluoromethyl compounds
{{organic-compound-stub}}