:SDB-006

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-benzyl-1-pentyl-1H-indole-3-carboxamide

| image = SDB-006_structure.png

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule II

| legal_UK = Class B

| legal_US =

| legal_DE = Anlage II

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 695213-59-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = MM02A5A302

| ChemSpiderID = 1665835

| ATC_prefix =

| ATC_suffix =

| PubChem = 2227769

| smiles = O=C(NCC1=CC=CC=C1)C2=CN(CCCCC)C3=CC=CC=C32

| C=21 | H=24 | N=2 | O=1

}}

SDB-006 is a drug that acts as a potent agonist for the cannabinoid receptors, with an EC₅₀ of 19 nM for human CB₂ receptors, and 134 nM for human CB₁ receptors.{{cite journal | vauthors = Banister SD, Stuart J, Kevin RC, Edington A, Longworth M, Wilkinson SM, Beinat C, Buchanan AS, Hibbs DE, Glass M, Connor M, McGregor IS, Kassiou M | title = Effects of bioisosteric fluorine in synthetic cannabinoid designer drugs JWH-018, AM-2201, UR-144, XLR-11, PB-22, 5F-PB-22, APICA, and STS-135 | journal = ACS Chemical Neuroscience | volume = 6 | issue = 8 | pages = 1445–58 | date = August 2015 | pmid = 25921407 | doi = 10.1021/acschemneuro.5b00107 | url = https://zenodo.org/record/47750 }}{{cite journal | vauthors = Banister SD, Olson A, Winchester M, Stuart J, Edington AR, Kevin RC, Longworth M, Herrera M, Connor M, McGregor IS, Gerona RR, Kassiou M | title = The chemistry and pharmacology of synthetic cannabinoid SDB-006 and its regioisomeric fluorinated and methoxylated analogs | journal = Drug Testing and Analysis | volume = 10 | issue = 7 | pages = 1099–1109 | date = January 2018 | pmid = 29350472 | doi = 10.1002/dta.2362 }} It was discovered during research into the related compound SDB-001 which had been sold illicitly as "2NE1".{{cite journal | vauthors = Banister SD, Wilkinson SM, Longworth M, Stuart J, Apetz N, English K, Brooker L, Goebel C, Hibbs DE, Glass M, Connor M, McGregor IS, Kassiou M | display-authors = 6 | title = The synthesis and pharmacological evaluation of adamantane-derived indoles: cannabimimetic drugs of abuse | journal = ACS Chemical Neuroscience | volume = 4 | issue = 7 | pages = 1081–92 | date = July 2013 | pmid = 23551277 | pmc = 3715837 | doi = 10.1021/cn400035r }} SDB-006 metabolism has been described in literature.{{cite journal | title=In vitro metabolism of new synthetic cannabinoid SDB-006 in human hepatocytes by high-resolution mass spectrometry | date=July 2017 | vauthors = Diao X, Carlier J, Scheidweiler KB, Huestis MA | journal=Forensic Toxicology | volume=35 | issue=2 | pages=252–262 | doi=10.1007/s11419-016-0350-9| s2cid=26558377 }}