:Santin (flavonol)

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477856896

| Name = Santin

| ImageFile = santin.svg

| ImageName = Chemical structure of santin

| IUPACName = 5,7-Dihydroxy-3,4′,6-trimethoxyflavone

| SystematicName = 5,7-Dihydroxy-3,6-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one

| OtherNames = 5,7-Dihydroxy-3,6,4′-trimethoxyflavone

|Section1={{Chembox Identifiers

| CASNo = 27782-63-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5785Y952EH

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNoOther =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 161957

| PubChem = 5281695

| SMILES = COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)O)OC)O)OC

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4445012

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 9024

| InChI = 1/C18H16O7/c1-22-10-6-4-9(5-7-10)16-18(24-3)15(21)13-12(25-16)8-11(19)17(23-2)14(13)20/h4-8,19-20H,1-3H3

| InChIKey = DWZAJFZEYZIHPO-UHFFFAOYAB

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H16O7/c1-22-10-6-4-9(5-7-10)16-18(24-3)15(21)13-12(25-16)8-11(19)17(23-2)14(13)20/h4-8,19-20H,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DWZAJFZEYZIHPO-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=18 | H=16 | O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Santin is an O-methylated flavonol. It was isolated from Tanacetum microphyllum.Martinez, J., et al. (1997). [https://www.ncbi.nlm.nih.gov/pubmed/9051913 Isolation of two flavonoids from Tanacetum microphyllum as PMA-induced ear edema inhibitors.] Journal of Natural Products 60(2), 142-44.