:Saridegib
{{short description|Experimental drug}}
{{refimprove|date=February 2016}}
{{Chembox
| verifiedrevid = 443867582
| ImageFile = Saridegib.svg
| ImageSize =
| IUPACName = N-[(5βH)-5,6-Dihydro-17,23β-epoxy-16a-homoveratraman-3α-yl]methanesulfonamide
| SystematicName = N-[(2S,3R,3′R,3aS,4′aR,6S,6′aR,6′bS,7aR,12′aS,12′bS)-3,6,11′,12′b-Tetramethyl-2′,3′,3a,4,4′,4′a,5,5′,6,6′,6′a,6′b,7,7′,7a,8′,10′,12′,12′a,12′b-icosahydro-1′H,3H-spiro[furo[3,2-b]pyridine-2,9′-naphtho[2,1-a]azulen]-3′-yl]methanesulfonamide
| OtherNames = saridegib
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 8198
| CASNo =1037210-93-7
| CASNo_Ref = {{cascite|correct|??}}
| PubChem = 25027363
| ChEMBL = 538867
| ChemSpiderID = 26353073
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = JT96FPU35X
| KEGG = D10324
| SMILES = C[C@H]1C[C@@H]2[C@H]([C@H]([C@]3(O2)CC[C@H]4[C@@H]5CC[C@@H]6C[C@@H](CC[C@@]6([C@H]5CC4=C(C3)C)C)NS(=O)(=O)C)C)NC1
| StdInChI=1S/C29H48N2O3S/c1-17-12-26-27(30-16-17)19(3)29(34-26)11-9-22-23-7-6-20-13-21(31-35(5,32)33)8-10-28(20,4)25(23)14-24(22)18(2)15-29/h17,19-23,25-27,30-31H,6-16H2,1-5H3/t17-,19+,20+,21+,22-,23-,25-,26+,27-,28-,29-/m0/s1
| StdInChIKey = HZLFFNCLTRVYJG-WWGOJCOQSA-N
}}
|Section2={{Chembox Properties
| C=29 | H=48 | N=2 | O=3 | S=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section4={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
|Section3={{Chembox Pharmacology
| Legal_status = Investigational
| AdminRoutes = Oral
}}
}}
Saridegib, also known as IPI-926, is an experimental drug candidate undergoing clinical trials for the treatment of various types of cancer, including hard-to-treat hematologic malignancies such as myelofibrosis and ligand-dependent tumors such as chondrosarcoma.{{cite web | url = http://www.infi.com/product-candidates-pipeline-ipi-926.asp | title = Pipeline: IPI-926 | publisher = Infinity Pharmaceuticals | url-status = unfit| archive-url = https://web.archive.org/web/20120119213055/http://www.infi.com/product-candidates-pipeline-ipi-926.asp | archive-date = 2012-01-19 }} IPI-926 exhibits its pharmacological effect by inhibition of the G protein-coupled receptor smoothened, a component of the hedgehog signaling pathway.{{cite journal | pmid = 19522463 | year = 2009 | last1 = Tremblay | first1 = MR | last2 = Lescarbeau | first2 = A | last3 = Grogan | first3 = MJ | last4 = Tan | first4 = E | last5 = Lin | first5 = G | last6 = Austad | first6 = BC | last7 = Yu | first7 = LC | last8 = Behnke | first8 = ML | last9 = Nair | first9 = SJ | last10 = Hagel | first10 = Margit | last11 = White | first11 = Kerry | last12 = Conley | first12 = James | last13 = Manna | first13 = Joseph D. | last14 = Alvarez-Diez | first14 = Teresa M. | last15 = Hoyt | first15 = Jennifer | last16 = Woodward | first16 = Caroline N. | last17 = Sydor | first17 = Jens R. | last18 = Pink | first18 = Melissa | last19 = MacDougall | first19 = John | last20 = Campbell | first20 = Matthew J. | last21 = Cushing | first21 = Jill | last22 = Ferguson | first22 = Jeanne | last23 = Curtis | first23 = Michael S. | last24 = McGovern | first24 = Karen | last25 = Read | first25 = Margaret A. | last26 = Palombella | first26 = Vito J. | last27 = Adams | first27 = Julian | last28 = Castro | first28 = Alfredo C. | title = Discovery of a potent and orally active hedgehog pathway antagonist (IPI-926) | volume = 52 | issue = 14 | pages = 4400–18 | doi = 10.1021/jm900305z | journal = Journal of Medicinal Chemistry| display-authors = 8 }} Chemically, it is a semi-synthetic derivative of the alkaloid cyclopamine. The process begins with cyclopamine extracted from harvested Veratrum californicum which is taken through a series of alterations resulting in an analogue of the natural product cyclopamine, making IPI-926 the only compound in development/testing that is not fully synthetic.
Saridegib is a member of a class of anti-cancer compounds known as hedgehog pathway inhibitors.{{cn|date=January 2025}}