:Saudin

{{Chembox

| ImageFile = Saudin.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 94978-16-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9X6I4D5FVQ

| PubChem = 6917902

| SMILES = C[C@@H]1C2C[C@@]3(O[C@@]4([C@]2([C@@]5(O3)COC(=O)[C@]5(CC4)C)C)OC1=O)C6=COC=C6}}

|Section2={{Chembox Properties

| C=20|H=22|O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Saudin is a diterpenoid first isolated from the African flowering plant Cluytia richardiana.{{cite journal | doi = 10.1021/jo00206a050 | title = Saudin, a hypoglycemic diterpenoid, with a novel 6,7-seco-labdane carbon skeleton, from Cluytia richardiana | journal = The Journal of Organic Chemistry | volume = 50 | issue = 6 | pages = 916–918 | year = 1985 | last1 = Mossa | first1 = Jaber S. | last2 = Cassady | first2 = John M. | last3 = Antoun | first3 = Mikhail D. | last4 = Byrn | first4 = Stephen R. | last5 = McKenzie | first5 = Ann T. | last6 = Kozlowski | first6 = John F. | last7 = Main | first7 = P. }}

Saudin has shown a hypoglycemic effect in an rodent model experiment.{{Cite journal | doi = 10.3109/13880208809053897 | title = The Hypoglycaemic Effect of Saudin | journal = International Journal of Crude Drug Research | volume = 26 | issue = 2 | pages = 81–87 | year = 1988 | last1 = Mossa | first1 = J. S. | last2 = El-Denshary | first2 = E. S. M. | last3 = Hindawi | first3 = R. | last4 = Ageel | first4 = A. M. }}

Because of the unusual chemical structure and its potential biological activity, there has been research aimed at its total synthesis.{{Cite journal | doi = 10.1016/j.tet.2011.09.067 | pmid = 22523435 | pmc = 3328808 | title = Studies culminating in the total synthesis and determination of the absolute configuration of (−)-saudin | journal = Tetrahedron | volume = 67 | issue = 51 | pages = 9787–9808 | year = 2011 | last1 = Boeckman | first1 = Robert K. | last2 = Rosario Ferreira | first2 = Maria Rico del | last3 = Mitchell | first3 = Lorna H. | last4 = Shao | first4 = Pengcheng | last5 = Neeb | first5 = Michael J. | last6 = Fang | first6 = Yue }}{{Cite journal | doi = 10.1080/00397919608004793 | title = Studies Toward the Total Synthesis of Saudine : Simple and Stereoselective Synthesis of a Model Caged Ketal Backbone | journal = Synthetic Communications | volume = 26 | issue = 24 | pages = 4671–4684 | year = 1996 | last1 = Labadie | first1 = Guillermo R. | last2 = Cravero | first2 = Raquel M. | last3 = González-Sierra | first3 = Manuel }}{{Cite journal | doi = 10.1021/ja017194i | title = An Enantioselective Total Synthesis of (+)- and (−)-Saudin. Determination of the Absolute Configuration | journal = Journal of the American Chemical Society | volume = 124 | issue = 2 | pages = 190–191 | year = 2002 | last1 = Boeckman | first1 = Robert K. | last2 = Del Rosario Rico Ferreira | first2 = Maria | last3 = Mitchell | first3 = Lorna H. | last4 = Shao | first4 = Pengcheng | pmid = 11782168 }}{{Cite journal | doi = 10.1021/ol050705b | pmid = 15932211 | title = Progress toward the Total Synthesis of Saudin: Development of a Tandem Stille-Oxa-Electrocyclization Reaction | journal = Organic Letters | volume = 7 | issue = 12 | pages = 2413–2416 | year = 2005 | last1 = Tambar | first1 = Uttam K. | last2 = Kano | first2 = Taichi | last3 = Stoltz | first3 = Brian M. | url = https://authors.library.caltech.edu/74471/2/ol050705bsi20050421_081713.pdf }}{{Cite journal | doi = 10.1021/jo061236+ | pmid = 17064005 | year = 2008 | last1 = Tambar | first1 = U. K. | title = Convergent and diastereoselective synthesis of the polycyclic pyran core of saudin | journal = The Journal of Organic Chemistry | volume = 71 | issue = 22 | pages = 8357–64 | last2 = Kano | first2 = T. | last3 = Zepernick | first3 = J. F. | last4 = Stoltz | first4 = B. M. | s2cid = 21506656 | url = https://authors.library.caltech.edu/74508/5/jo061236%252Bsi20060901_075757.pdf }}

References

{{reflist}}

Category:Diterpenes

{{organic-compound-stub}}