:Scholarine

{{Chembox

| ImageFile = Scholarine.svg

| ImageSize = 200px

| IUPACName = Methyl (19S)-19-hydroxy-12-methoxy-2,16-didehydrocuran-17-oate

| SystematicName = Methyl (3aS,5S,11bR,12S)-12-[(1S)-1-hydroxyethyl]-8-methoxy-1,2,3a,4,5,7-hexahydro-3,5-ethanopyrrolo[2,3-d]carbazole-6-carboxylate

| OtherNames = 12-Methoxyechitamidine

|Section1={{Chembox Identifiers

| CASNo = 78897-55-9

| CASNo_Ref = {{cascite|correct|CAS}}

| ChEBI = 70501

| ChEMBL = 523826

| PubChem = 21586664

| PubChem_Comment =

| ChemSpiderID = 10202305

| SMILES = C[C@@H]([C@@H]1CN2CC[C@@]34[C@@H]2C[C@@H]1C(=C3Nc5c4cccc5OC)C(=O)OC)O

| InChI=1S/C21H26N2O4/c1-11(24)13-10-23-8-7-21-14-5-4-6-15(26-2)18(14)22-19(21)17(20(25)27-3)12(13)9-16(21)23/h4-6,11-13,16,22,24H,7-10H2,1-3H3/t11-,12-,13-,16-,21+/m0/s1

| InChIKey=FNDWOLJMJUSGOB-CSXNJMRASA-N

}}

|Section2={{Chembox Properties

| C=21|H=26|N=2|O=4

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

| Solubility =

| SolubleOther =

| Solvent =

}}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape = }}

|Section4={{Chembox Thermochemistry

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity = }}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US = }}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor = }}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| HPhrases =

| PPhrases =

| GHS_ref =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL = }}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = }}

}}

Scholarine is an alkaloid isolated initially from Alstonia scholaris by Banerji and Siddhanta. Subsequently, it was obtained from the West African tree Alstonia boonei.{{cite book|author=John Edwin Saxton|title=Monoterpenoid indole alkaloids: Supplement to Part 4|url=https://books.google.com/books?id=5eFPAAAAYAAJ|access-date=25 August 2013|volume=4|date=15 December 1994|publisher=Wiley|isbn=978-0-471-95112-4|page=287}} The derivative N-Formylscholarine has been isolated from the fruit pods of Alstonia scholaris.{{cite journal |pmid=19851925 |year=2009 |last1=Jain |first1=L |last2=Pandey |first2=MB |last3=Singh |first3=S |last4=Singh |first4=AK |last5=Pandey |first5=VB |title=A new indole alkaloid from Alstonia scholaris |volume=23 |issue=17 |pages=1599–602 |doi=10.1080/14786410802547499 |journal=Natural Product Research|s2cid=26325499 }}

File:Formylscholarine.svg{{clear-left}}