:Sodium ricinoleate

{{chembox

| verifiedrevid =

| ImageFile=Sodium ricinoleate.svg

| ImageSize=250px

| PIN=Sodium (9Z,12R)-12-hydroxyoctadec-9-enoate

| OtherNames=Ricinoleic acid sodium salt

|Section1={{Chembox Identifiers

| CASNo = 5323-95-5

| CASNo_Ref = {{cascite|correct|}}

| ChemSpiderID = 17215848

| EC_number = 226-191-2

| RTECS = VJ3500000

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = OOO64813BX

| PubChem = 23687338

| SMILES = O[C@H](CCCCCC)C/C=C\CCCCCCCC([O-])=O.[Na+]

| StdInChI = 1S/C18H34O3.Na/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);/q;+1/p-1/b12-9-;/t17-;/m1./s1

| StdInChIKey = IJRHDFLHUATAOS-DPMBMXLASA-M

}}

|Section2={{Chembox Properties

| C=18 | H=33 | Na=1 | O=3

| Appearance= Pale white solid

| Density=

| MeltingPtC=

| BoilingPt=

| Solubility=

}}

}}

Sodium ricinoleate is the sodium salt of ricinoleic acid, the principal fatty acid derived from castor oil.{{sfnp|Dunn|2010|p=187}} It is used in making soap, where its molecular structure causes it to lather more easily than comparable sodium soaps derived from fatty acids.{{sfnp|Dunn|2010|p=187}} It is a bactericide.{{sfnp|Ann Surg|1932}} It exhibits several polymorphic structural phases.{{sfnp|Liquid Crystals|1994}}

As a surfactant, sodium ricinoleate is an irritant to human skin and mucous membranes, causing hypersensitivity responses. These are due to castor bean constituents, which can be removed in order to prepare it as a food-grade ingredient.{{sfnp|Food Chem Toxicol|2006}}

Sodium ricinoleate was a constituent in toothpaste and was the 'SR' of Gibbs SR toothpaste, the first product to be advertised on British TV (in 1955).