:Statine

{{About|the amino acid|the group of cholesterol lowering drugs|Statin}}

{{chembox

| ImageFile = Statine skeletal.svg

| IUPACName = (3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid

| Section1 = {{Chembox Identifiers

| Abbreviations = AHMHA, Sta

| CASNo = 49642-07-1

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = YTC77XR1EK

| PubChem = 123915

| ChemSpiderID = 110446

| SMILES = N[C@@H](CC(C)C)[C@@H](O)CC(O)=O

| InChI = 1S/C8H17NO3/c1-5(2)3-6(9)7(10)4-8(11)12/h5-7,10H,3-4,9H2,1-2H3,(H,11,12)/t6-,7-/m0/s1

| InChIKey = DFVFTMTWCUHJBL-BQBZGAKWSA-N

| ChEBI = 45769

}}

| Section2 = {{Chembox Properties

| C=8 | H=17 | N=1 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

}}

Statine is a gamma amino acid that occurs twice in the sequence of pepstatin, a protease inhibitor that is active against pepsin and other acid proteases.{{Cite journal

| last1 = Umezawa | first1 = H.

| last2 = Aoyagi | first2 = T.

| last3 = Morishima | first3 = H.

| last4 = Matsuzaki | first4 = M.

| last5 = Hamada | first5 = M.

| last6 = Takeuchi | first6 = T.

| title = Pepstatin, a new pepsin inhibitor produced by Actinomycetes

| journal = The Journal of Antibiotics

| volume = 23

| issue = 5

| pages = 259–262

| year = 1970

| pmid = 4912600 | doi=10.7164/antibiotics.23.259

| doi-access = free

}} It is thought to be responsible for the inhibitory activity of pepstatin because it mimics the tetrahedral transition state of peptide catalysis.{{Cite journal

| last1 = Marciniszyn Jr | first1 = J.

| last2 = Hartsuck | first2 = J. A.

| last3 = Tang | first3 = J.

| title = Mode of inhibition of acid proteases by pepstatin

| journal = The Journal of Biological Chemistry

| volume = 251

| issue = 22

| pages = 7088–7094

| year = 1976

| doi = 10.1016/S0021-9258(17)32945-9

| pmid = 993206

| doi-access = free

}}