:Sulfacytine
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 4-Amino-N-(1-ethyl-2-oxo-1,2-dihydropyrimidin-4-yl)benzene-1-sulfonamide
| image = Sulfacytine v2.svg
| width =
| alt =
| image2 = Sulfacytine 3D.png
| width2 =
| drug_name =
| tradename =
| licence_EU =
| licence_US =
| DailyMedID =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| dependency_liability =
| routes_of_administration = Oral
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 17784-12-2
| CAS_supplemental =
| ATCvet =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 5322
| PubChemSubstance = 46505483
| IUPHAR_ligand =
| DrugBank = DB01298
| ChemSpiderID = 5131
| UNII = T795873AJP
| ChEMBL = 1201056
| synonyms = {{unbulletedlist|1-Ethyl N4-sulfanilylcytosine | 1-Ethyl-N-sulfanilylcytosine | N-Sulfanilyl-l-ethylcytosine | Sulfacitina [inn-spanish] | Sulfacitinum [inn-latin] }}
| C=12 | H=14 | N=4 | O=3 | S=1
| molecular_weight =
| SMILES = CCN1C=CC(NS(=O)(=O)C2=CC=C(N)C=C2)=NC1=O
| StdInChI = InChI=1S/C12H14N4O3S/c1-2-16-8-7-11(14-12(16)17)15-20(18,19)10-5-3-9(13)4-6-10/h3-8H,2,13H2,1H3,(H,14,15,17)
| StdInChIKey = SIBQAECNSSQUOD-UHFFFAOYSA-N
| density =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| specific_rotation =
| sec_combustion =
}}
Sulfacytine is a short-acting sulfonamide antibiotic,{{DrugBank|DB01298}} taken orally for treatment against bacterial infections. Sulfonamides, as a group of antibiotics, work by inhibiting the bacterial synthesis of folate. In 2006, the drug was discontinued.Federal Register
[https://www.fda.gov/downloads/advisorycommittees/committeesmeetingmaterials/drugs/pharmacycompoundingadvisorycommittee/ucm433804.pdf Section: Food and Drug Administration] [Docket No. 2006N–0222] Merck & Co., Inc., et al.; Withdrawal of Approval of 65 New Drug Applications and 52 Abbreviated New Drug Applications] Vol. 71, No. 116 / Friday, June 16, 2006. p34941FDA Orange book. [http://www.accessdata.fda.gov/scripts/cder/ob/docs/obdetail.cfm?Appl_No=017569&TABLE1=OB_Disc Sulfacytine] Page accessed May 12, 2015