:TAN-1057 A

{{Chembox

| Verifiedfields = changed

| verifiedrevid = 470482351

| Name=TAN-1057 (A, B)

| ImageFile1 = TAN-1057A.png

| ImageSize1 =

| ImageCaption1 = TAN-1057 A

| ImageFile2 = TAN-1057B.png

| ImageSize2 =

| ImageCaption2 = TAN-1057 B

| IUPACName =

| OtherNames =

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 110872

| InChI = 1/C13H25N9O3/c1-22(8-6-19-13(20-10(8)24)21-12(17)25)9(23)5-7(14)3-2-4-18-11(15)16/h7-8H,2-6,14H2,1H3,(H4,15,16,18)(H4,17,19,20,21,24,25)/t7-,8+/m0/s1

| InChIKey = ZMWBCGMRXBPXEU-JGVFFNPUBF

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H25N9O3/c1-22(8-6-19-13(20-10(8)24)21-12(17)25)9(23)5-7(14)3-2-4-18-11(15)16/h7-8H,2-6,14H2,1H3,(H4,15,16,18)(H4,17,19,20,21,24,25)/t7-,8+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZMWBCGMRXBPXEU-JGVFFNPUSA-N

| CASNo1_Ref = {{cascite|changed|??}}

| CASNo1 = 128126-44-3

| CASNo1_Comment = (TAN-1057 A)

| CASNo2_Ref = {{cascite|changed|??}}

| CASNo2 = 128126-45-4

| CASNo2_Comment = (TAN-1057 B)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 74EKN36H9V

| PubChem = 124498

| SMILES = O=C1N\C(=N/C[C@H]1N(C(=O)C[C@@H](N)CCC/N=C(\N)N)C)NC(=O)N

}}

| Section2 = {{Chembox Properties

| C=13| H=25| N=9| O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

TAN-1057 A and TAN-1057 B are organic compounds found in the Flexibacter sp. PK-74 bacterium. TAN-1057 A and B are closely related structurally as diastereomers. Also related are TAN-1057 C and TAN-1057 D, isolated from the same bacteria. The four compounds have been shown to be an effective antibiotics against methicillin-resistant strains of Staphylococcus aureus which act through the inhibition of protein biosynthesis.{{cite journal | author=Katayama, N | title=TAN-1057 A-D, new antibiotics with potent antibacterial activity against methicillin-resistant Staphylococcus aureus. Taxonomy, fermentation and biological activity | journal=J. Antibiot. | year=1993 | pages=606–613 | volume=46 | issue=4 | pmid=8501003 | display-authors=1 | last2=Fukusumi | first2=S | last3=Funabashi | first3=Y | last4=Iwahi | first4=T | last5=Ono | first5=H | doi=10.7164/antibiotics.46.606| doi-access=free }}