:TAN-1057 C

{{Chembox

| Verifiedfields = changed

| verifiedrevid = 470482224

| Name={{nowrap|TAN-1057 C}} and {{nowrap|TAN-1057 D}}

| ImageFile1 = TAN-1057C.png

| ImageSize1 =

| ImageAlt1 = TAN-1057 C

| ImageCaption1 = TAN-1057 C

| ImageFile2 = TAN-1057D.png

| ImageAlt2 = TAN-1057 D

| ImageCaption2 = TAN-1057 D

| IUPACName =

| OtherNames =

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 7851330

| InChI = 1/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1

| InChIKey = PNFFUPQADHHLMN-DTWKUNHWBI

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PNFFUPQADHHLMN-DTWKUNHWSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 128126-46-5

| CASNo_Comment = (TAN-1057 C)

| CASNo2_Ref = {{cascite|changed|??}}

| CASNo2 = 128126-47-6

| CASNo2_Comment = (TAN-1057 D)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7TWX2V5P6Q

| PubChem = 9576889

| SMILES = O=C1N(C)[C@@H](C(=O)N[C@H](C1)CCC/N=C(\N)N)CNN\C=N\C(=O)N

}}

| Section2 = {{Chembox Properties

| C=13| H=25| N=9| O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

TAN-1057 C and TAN-1057 D are organic compounds found in the Flexibacter sp. PK-74 bacterium. TAN-1057 C and D are closely related structurally as diastereomers. Also related are TAN-1057 A and TAN-1057 B, isolated from the same bacteria. The four compounds have been shown to be an effective antibiotics against methicillin-resistant strains of Staphylococcus aureus which act through the inhibition of protein biosynthesis.{{cite journal | author=Katayama, N| title=TAN-1057 A-D, new antibiotics with potent antibacterial activity against methicillin-resistant Staphylococcus aureus. Taxonomy, fermentation and biological activity | journal=J. Antibiot. | year=1993 | pages=606–613 | volume=46 | issue=4 | pmid=8501003 | doi=10.7164/antibiotics.46.606|display-authors=etal| doi-access=free }}