:TAN-1057 C
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 470482224
| Name={{nowrap|TAN-1057 C}} and {{nowrap|TAN-1057 D}}
| ImageFile1 = TAN-1057C.png
| ImageSize1 =
| ImageAlt1 = TAN-1057 C
| ImageCaption1 = TAN-1057 C
| ImageFile2 = TAN-1057D.png
| ImageAlt2 = TAN-1057 D
| ImageCaption2 = TAN-1057 D
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 7851330
| InChI = 1/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1
| InChIKey = PNFFUPQADHHLMN-DTWKUNHWBI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PNFFUPQADHHLMN-DTWKUNHWSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 128126-46-5
| CASNo_Comment = (TAN-1057 C)
| CASNo2_Ref = {{cascite|changed|??}}
| CASNo2 = 128126-47-6
| CASNo2_Comment = (TAN-1057 D)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7TWX2V5P6Q
| PubChem = 9576889
| SMILES = O=C1N(C)[C@@H](C(=O)N[C@H](C1)CCC/N=C(\N)N)CNN\C=N\C(=O)N
}}
| Section2 = {{Chembox Properties
| C=13| H=25| N=9| O=3
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
TAN-1057 C and TAN-1057 D are organic compounds found in the Flexibacter sp. PK-74 bacterium. TAN-1057 C and D are closely related structurally as diastereomers. Also related are TAN-1057 A and TAN-1057 B, isolated from the same bacteria. The four compounds have been shown to be an effective antibiotics against methicillin-resistant strains of Staphylococcus aureus which act through the inhibition of protein biosynthesis.{{cite journal | author=Katayama, N| title=TAN-1057 A-D, new antibiotics with potent antibacterial activity against methicillin-resistant Staphylococcus aureus. Taxonomy, fermentation and biological activity | journal=J. Antibiot. | year=1993 | pages=606–613 | volume=46 | issue=4 | pmid=8501003 | doi=10.7164/antibiotics.46.606|display-authors=etal| doi-access=free }}
References
{{reflist}}
{{antibiotic-stub}}