:TC-1827

{{Chembox

| ImageFile = TC-1827.svg

| ImageSize = 200px

| ImageAlt =

| PIN = (2S,4E)-N-Methyl-5-(pyrimidin-5-yl)pent-4-en-2-amine

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 547741-76-4

| CASNo_Ref = {{cascite|correct|CAS}}

| ChemSpiderID = 8329797

| PubChem = 10154289

| SMILES = C[C@H](NC)C/C=C/C1=CN=CN=C1

| StdInChI=1S/C10H15N3/c1-9(11-2)4-3-5-10-6-12-8-13-7-10/h3,5-9,11H,4H2,1-2H3/b5-3+/t9-/m0/s1

| StdInChIKey = VZNTWLIIJWUCEP-SGRBOOSSSA-N

}}

|Section2={{Chembox Properties

| C=10 | H=15 | N=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

TC-1827 is an orally active, selective agonist of the α₄β₂ nicotinic receptors. Administration of TC-1827 improved memory and learning in a variety of rodents and increased long-term potentiation in hippocampal slices. In addition, the compound was without significant cardiovascular side effects, except for a small, transient rise in arterial blood pressure. The pro-cognitive effects of TC-1827 last much longer than the short half life (0.2 - 1.0 hours) would suggest.{{cite journal|last=Bohme|first=Georg Andrees|title=In vitro and in vivo characterization of TC-1827, a novel brain α4β2 nicotinic receptor agonist with pro-cognitive activity|journal=Drug Development Research|date=May 2004|volume=62|issue=1|pages=26–40|doi=10.1002/ddr.10352|s2cid=86072368}}