:Talk:(R)-2-Methyl-CBS-oxazaborolidine
{{WikiProject banner shell|class=Start|
{{WikiProject Chemicals|importance=low}}
}}
Table - what is the intention?
This table does not appear to have a coherent message, nor follow WP guidelines for an article. What is the intention?--CaroleHenson (talk) 04:27, 4 January 2012 (UTC)
| style="width:30%; height:200px" border="1" align="right" |
| (R)-2-Methyl-CBS-oxazaborolidine |
|---|
| File:(R)-2-Methyl-CBS-oxazaborolidine.jpg |
| IUPAC name (3aR)-1-Methyl-3,3-diphenyltetrahydro-3H-pyrrolo [1,2-c][1,3,2]oxazaborole |
| Other name (R)-Methyl oxazaborolidine (R)-(+)-2-methyl-CBS-oxazaborolidine |
| Identifiers CAS number: 112022-83-0 ChemSpider: 8014210 Jmol-3D images:[http://www.chemspider.com/ImageView.aspx?mode=3d&id=8014210 Image 1] |
| SMILES O2B(N1CCC[C@@H]1C2(c3ccccc3)c4ccccc4)C |
| InChI 1S/C18H20BNO/c1-19-20-14-8-13-17(20)18(21-19,15-9-4-2-5- 10-15)16-11-6-3-7-12-16/h2-7,9-12,17H,8,13-14H2,1H3/t17-/m1/s1 |
| Properties |
| Molecular formula: C18H20BNO Molar mass: 277.17 Appearance: Colorless to pale yellow liquid (in toluene) Density: 0.95 g/mL at 25 °C Melting point: 85-95 °C Boiling point: 111 °C Flash point: 40°F toluene |
| Hazards |
| EU classification: File:Highly flammable(F).jpg File:Hamful(Xn).jpg
R-phrases: R17 |
