:Tangshenoside I
{{short description|Chemical compound}}
{{notability|date=March 2015}}
{{Chembox
| ImageFile = Tangshenoside I Structure.svg
| ImageSize =
| ImageAlt =
| IUPACName =
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 117278-74-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9WKT543Z4X
| PubChem = 6441191
| ChemSpiderID = 4945396
| SMILES = CC(CC(=O)O)(CC(=O)OC/C=C/c1cc(c(c(c1)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O
| InChI = 1/C29H42O18/c1-29(9-18(32)33,47-28-25(40)23(38)21(36)17(12-31)45-28)10-19(34)43-6-4-5-13-7-14(41-2)26(15(8-13)42-3)46-27-24(39)22(37)20(35)16(11-30)44-27/h4-5,7-8,16-17,20-25,27-28,30-31,35-40H,6,9-12H2,1-3H3,(H,32,33)/b5-4+/t16-,17-,20-,21-,22+,23+,24-,25-,27+,28+,29?/m1/s1
| InChIKey = ABKPQICIFGNRAA-YCRPTBBLBT
| StdInChI = 1S/C29H42O18/c1-29(9-18(32)33,47-28-25(40)23(38)21(36)17(12-31)45-28)10-19(34)43-6-4-5-13-7-14(41-2)26(15(8-13)42-3)46-27-24(39)22(37)20(35)16(11-30)44-27/h4-5,7-8,16-17,20-25,27-28,30-31,35-40H,6,9-12H2,1-3H3,(H,32,33)/b5-4+/t16-,17-,20-,21-,22+,23+,24-,25-,27+,28+,29?/m1/s1
| StdInChIKey = ABKPQICIFGNRAA-YCRPTBBLSA-N
| RTECS =
}}
|Section2={{Chembox Properties
| C=29 | H=42 | O=18
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Tangshenoside I is a chemical compound isolated from Codonopsis pilosula.{{cite journal| pmid=2092716 | volume=15 | title= [Determination of tangshenoside I in Codonopsis pilosula Nannf. by TLC-UV spectrophotometric method] | year=1990 | journal=Zhongguo Zhong Yao Za Zhi | pages=553–5, 577 | last1 = Han | first1 = G | last2 = Wang | first2 = C | last3 = Su | first3 = X | last4 = He | first4 = X | last5 = Wang | first5 = Y | last6 = Kenji | first6 = M | last7 = Osamu | first7 = T| issue=9 }} It can be considered a syringin molecule bound to meglutol glucoside.