:Tin(II) 2-ethylhexanoate

{{Chembox

| ImageFile =Tin(II) 2-ethylhexanoate.svg

| ImageSize =200px

| IUPACName = Tin(2+) bis(2-ethylhexanoate)

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 301-10-0

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 519A78R12Y

| PubChem = 16689712

| ChemSpiderID = 8957

| SMILES = CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Sn+2]

| InChI = 1S/2C8H16O2.Sn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2

}}

|Section2={{Chembox Properties

| C=16 | H=30 | O=4 | Sn=1

| Appearance = Yellow liquid

| Density = 1.251 g/cm³

| MeltingPt= <

| MeltingPtC = 0

| BoilingPt= ~

| BoilingPtC = 130 to 150

| BoilingPt_notes = at 30 mTorr

| Solubility = Degrades in water to form Sn(IV)

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPtC = 113

| FlashPt_notes = closed cup

| AutoignitionPt =

}}

}}

Tin(II) 2-ethylhexanoate or tin(II) octoate or stannous octoate (Sn(Oct)₂)Sometimes misleadingly tin(II) octanoate. is the octaoate or 2-ethylhexanoate salt of tin. Produced by the reaction of tin(II) oxide and 2-ethylhexanoic acid, it is a clear colorless liquid at room temperature, though often appears yellow due to impurities, likely resulting from oxidation of Sn(II) to Sn(IV).{{cite book | doi = 10.1002/9783527603978.mst0079 | chapter = Tin | year = 2006 | last1 = Kumar Suri | first1 = Ashok | last2 = Banerjee | first2 = Srikuman | title = Materials Science and Technology| isbn = 9783527603978 }}

It is sometimes used as a catalyst for ring-opening polymerization, such as for the production of polylactic acid.{{cite journal | doi = 10.1002/(SICI)1099-0518(19971130)35:16<3431::AID-POLA10>3.0.CO;2-G | title = More about the polymerization of lactides in the presence of stannous octoate | year = 1997 | last1 = Schwach | first1 = G. | last2 = Coudane | first2 = J. | last3 = Engel | first3 = R. | last4 = Vert | first4 = M. | journal = Journal of Polymer Science Part A: Polymer Chemistry | volume = 35 | issue = 16 | pages = 3431–3440| bibcode = 1997JPoSA..35.3431S }}