:Tiquinamide

{{more citations needed|date=February 2022}}

{{Chembox

| ImageFile = Tiquinamide.svg

| ImageSize = 150px

| ImageAlt =

| PIN = 3-Methyl-5,6,7,8-tetrahydroquinoline-8-carbothioamide

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 53400-67-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 51O951X8V9

| PubChem = 3003921

| ChemSpiderID = 2274315

| StdInChI = 1S/C11H14N2S/c1-7-5-8-3-2-4-9(11(12)14)10(8)13-6-7/h5-6,9H,2-4H2,1H3,(H2,12,14)

| StdInChIKey = AIMIAJHGOMWBQG-UHFFFAOYSA-N

| SMILES = Cc1cc2c(nc1)C(CCC2)C(=S)N

}}

|Section2={{Chembox Properties

| C=11 | H=14 | N=2 | S=1

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Tiquinamide is a gastric acid synthesis inhibitor.{{cite journal |doi=10.1111/j.1365-2125.1976.tb00655.x |title=Pharmacokinetic studies on tiquinamide, a novel inhibitor of gastric acid secretion |year=1976 |last1=Pierce |first1=DM |last2=Franklin |first2=RA |last3=Southgate |first3=RJ |journal=British Journal of Clinical Pharmacology |volume=3 |issue=5 |pages=943–945 |pmid=973994 |pmc=1428943 }}