:Tolpiprazole

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(3-Methylphenyl)-4-[2-(5-methyl-1H-pyrazol-3-yl)ethyl]piperazine

| image = Tolpiprazole.png

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 20326-13-0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 3084338

| ChemSpiderID = 2341419

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8XP74P4HO3

| C=17 | H=24 | N=4

| smiles = Cc3cccc(N2CCN(CCc1cc(C)[nH]n1)CC2)c3

}}

Tolpiprazole (INN, BAN) (developmental code name H-4170) is an anxiolytic drug of the phenylpiperazine group that was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1217|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=1217–}}

See also

References