:Trifucol

{{Chembox

| ImageFile = Trifucol.svg

| ImageSize = 250px

| ImageAlt = Chemical structure of trifucol

| PIN = [1¹,2¹:2³,3¹-Terphenyl]-1²,1⁴,1⁶,2²,2⁴,2⁶,3²,3⁴,3⁶-nonol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 62218-04-6

| CASNo_Ref = {{cascite|correct|CAS}}

| ChemSpiderID = 35802528

| PubChem = 71401226

| UNII = U7NO04BE05

| InChI = 1S/C18H14O9/c19-6-1-8(21)14(9(22)2-6)16-12(25)5-13(26)17(18(16)27)15-10(23)3-7(20)4-11(15)24/h1-5,19-27H

| InChIKey = COTZPIUJHGYKAQ-UHFFFAOYSA-N

| SMILES = C1=C(C(=C(C(=C1O)C2=C(C=C(C=C2O)O)O)O)C3=C(C=C(C=C3O)O)O)O

}}

|Section2={{Chembox Properties

| Formula = C₁₈H₁₄O₉

| MolarMass = 374.29 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Trifucol is a phlorotannin found in the brown algae Scytothamnus australis and Analipus japonicus.{{cite journal |doi=10.1016/0031-9422(76)85094-7 |title=Polyhydroxyoligophenyle und phenyläther aus Bifurcaria bifurcata |year=1976 |last1=Glombitza |first1=Karl-Werner |last2=Rösener |first2=Hans-Udo |last3=Koch |first3=Marieluise |journal=Phytochemistry |volume=15 |issue=8 |pages=1279–1281 |bibcode=1976PChem..15.1279G |language=de }}{{cite journal |doi=10.1039/B600518G |title=Phloroglucinol compounds of natural origin |year=2006 |last1=Pal Singh |first1=Inder |last2=Bharate |first2=Sandip B. |journal=Natural Product Reports |volume=23 |issue=4 |pages=558–591 |pmid=16874390 }}