:Trifucol
{{Chembox
| ImageFile = Trifucol.svg
| ImageSize = 250px
| ImageAlt = Chemical structure of trifucol
| PIN = [11,21:23,31-Terphenyl]-12,14,16,22,24,26,32,34,36-nonol
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 62218-04-6
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 35802528
| PubChem = 71401226
| UNII = U7NO04BE05
| InChI = 1S/C18H14O9/c19-6-1-8(21)14(9(22)2-6)16-12(25)5-13(26)17(18(16)27)15-10(23)3-7(20)4-11(15)24/h1-5,19-27H
| InChIKey = COTZPIUJHGYKAQ-UHFFFAOYSA-N
| SMILES = C1=C(C(=C(C(=C1O)C2=C(C=C(C=C2O)O)O)O)C3=C(C=C(C=C3O)O)O)O
}}
|Section2={{Chembox Properties
| Formula = C18H14O9
| MolarMass = 374.29 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Trifucol is a phlorotannin found in the brown algae Scytothamnus australis and Analipus japonicus.{{cite journal |doi=10.1016/0031-9422(76)85094-7 |title=Polyhydroxyoligophenyle und phenyläther aus Bifurcaria bifurcata |year=1976 |last1=Glombitza |first1=Karl-Werner |last2=Rösener |first2=Hans-Udo |last3=Koch |first3=Marieluise |journal=Phytochemistry |volume=15 |issue=8 |pages=1279–1281 |bibcode=1976PChem..15.1279G |language=de }}{{cite journal |doi=10.1039/B600518G |title=Phloroglucinol compounds of natural origin |year=2006 |last1=Pal Singh |first1=Inder |last2=Bharate |first2=Sandip B. |journal=Natural Product Reports |volume=23 |issue=4 |pages=558–591 |pmid=16874390 }}