:Trimetozine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = Morpholin-4-yl-(3,4,5-trimethoxyphenyl)methanone

| image = Trimetozine.svg

| tradename =

| Drugs.com = {{drugs.com|international|trimetozine}}

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 635-41-6

| ATC_prefix = none

| ATC_suffix =

| PubChem = 12478

| ChemSpiderID = 11968

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 31EPT7G9PL

| ChEMBL = 1697853

| C=14 | H=19 | N=1 | O=5

| smiles = COC1=CC(=CC(=C1OC)OC)C(=O)N2CCOCC2

}}

Trimetozine (Opalene, Trimolide, Trioxazine) is a sedative that has been marketed in Europe since 1959.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | pages = 1932 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&q=trimetozine&pg=PA1067}}{{cite book | author = David J. Triggle | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=A0THacd46ZsC&q=trimetozine&pg=PA2065}} It also has mild tranquilizing effects and has been used in the treatment of anxiety.{{cite journal | vauthors = Taverna P, Ferrari G | title = [Clinical trial of a new tranquilizing agent: trioxazine] | language = it | journal = Minerva Medica | volume = 61 | issue = 46 | pages = 2574–90 | date = June 1970 | pmid = 5425739 }}{{cite journal | vauthors = Shpak VM, Shcheglova AI | title = [Trioxazine in the treatment of night anxiety in children] | language = ru | journal = Pediatriia | volume = 47 | issue = 8 | pages = 76–7 | date = August 1968 | pmid = 5730033 }} Its mechanism of action is unclear.{{Citation needed|date=August 2010}}

Conversion of the amide in trimetozine to the thioamide gives Tritiozine.

References