:UK-432,097

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 420447010

| ImageFile = UK-432,097.svg

| ImageSize = 330

| ImageName = Kekulé skeletal formula of UK-432,097

| SystematicName = (1²R,1³R,1⁴S,1⁵S)-2⁶-[(2,2-Diphenylethyl)amino]-N-ethyl-1³,1⁴-dihydroxy-3,8-dioxo-4,7,9-triaza-2(9,2)-purina-11(2)-pyridina-10(4,1)-piperidina-1(2)-oxolanaundecaphane-1⁵-carboxamide

| Section1 = {{Chembox Identifiers

| Abbreviations = UK-432,097

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 380221-63-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8L3OAJ1R5A

| PubChem = 9833519

| ChEMBL = 1096896

| SMILES = O=C(NCC)[C@H]([C@@H](O)[C@H]1O)O[C@H]1N2C=NC3=C(NCC(C4=CC=CC=C4)C5=CC=CC=C5)N=C(C(NCCNC(NC6CCN(C7=NC=CC=C7)CC6)=O)=O)N=C32

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8009243

| SMILES2 = O=C(NC2CCN(c1ncccc1)CC2)NCCNC(=O)c5nc3c(ncn3[C@@H]4O[C@H](C(=O)NCC)[C@@H](O)[C@H]4O)c(n5)NCC(c6ccccc6)c7ccccc7

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C40H47N11O6/c1-2-41-37(54)33-31(52)32(53)39(57-33)51-24-46-30-34(45-23-28(25-11-5-3-6-12-25)26-13-7-4-8-14-26)48-35(49-36(30)51)38(55)43-19-20-44-40(56)47-27-16-21-50(22-17-27)29-15-9-10-18-42-29/h3-15,18,24,27-28,31-33,39,52-53H,2,16-17,19-23H2,1H3,(H,41,54)(H,43,55)(H2,44,47,56)(H,45,48,49)/t31-,32+,33-,39+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZOTHAEBAWXWVID-HXEFRTELSA-N

}}

| Section2 = {{Chembox Properties

| C=40 | H=47 | N=11 | O=6

}}

}}

UK-432,097 is a drug developed by Pfizer for the treatment of chronic obstructive pulmonary disease, which acts as a potent and selective agonist of the adenosine A_2A receptor.{{Cite journal | last1 = Russo | first1 = Cristina | last2 = Arcidiacono | first2 = Giuseppe | last3 = Polosa | first3 = Riccardo | doi = 10.1111/j.1472-8206.2005.00388.x | title = Adenosine receptors: promising targets for the development of novel therapeutics and diagnostics for asthma | journal = Fundamental and Clinical Pharmacology | volume = 20 | issue = 1 | pages = 9–19 | year = 2006 | pmid = 16448391| s2cid = 20463970 }} It was discontinued from clinical trials following poor efficacy results,[http://clinicaltrials.gov/ct2/show/results/NCT00430300 Safety And Efficacy Of UK-432,097 In Chronic Obstructive Pulmonary Disease. ClinicalTrials.gov] but its high selectivity has made it useful for detailed mapping of the internal structure of the A_2A receptor.{{cite journal |vauthors=Xu F, Wu H, Katritch V, Han GW, Jacobson KA, Gao ZG, Cherezov V, Stevens RC |title=Structure of an Agonist-Bound Human A2A Adenosine Receptor |journal=Science |volume= 332|issue= 6027|pages= 322–7|date=March 2011 |pmid=21393508 |doi=10.1126/science.1202793 |pmc=3086811|bibcode=2011Sci...332..322X }}