:Ungeremine

{{Chembox

| ImageFile = Ungeremine.svg

| ImageSize = 200px

| PIN = 2-Hydroxy-4,5-dihydro-10H-6λ⁵-[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridin-6-ylium

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 2121-12-2

| CASNo_Ref = {{cascite|correct|CAS}}

| ChEMBL = 253553

| KEGG = C12189

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9EVC5B2RPS

| PubChem = 159646

| ChemSpiderID = 140368

| SMILES = C1C[N+]2=CC3=CC4=C(C=C3C5=CC(=CC1=C52)O)OCO4

| InChI = 1/C16H11NO3/c18-11-3-9-1-2-17-7-10-4-14-15(20-8-19-14)6-12(10)13(5-11)16(9)17/h3-7H,1-2,8H2/p+1

| InChIKey = DFQOXFIPAAMFAU-IKLDFBCSAD

| StdInChI = 1S/C16H11NO3/c18-11-3-9-1-2-17-7-10-4-14-15(20-8-19-14)6-12(10)13(5-11)16(9)17/h3-7H,1-2,8H2/p+1

| StdInChIKey = DFQOXFIPAAMFAU-UHFFFAOYSA-O

}}

|Section2={{Chembox Properties

| C=16|H=12|N=1|O=3

| Formula_Charge=+1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Ungeremine is a betaine-type alkaloid isolated from Nerine bowdenii{{cite journal | pmid=15516727 | year=2004 | last1=Rhee | first1=I. K. | title=Isolation of the acetylcholinesterase inhibitor ungeremine from Nerine bowdenii by preparative HPLC coupled on-line to a flow assay system | journal=Biological & Pharmaceutical Bulletin | volume=27 | issue=11 | pages=1804–9 | last2=Appels | first2=N | last3=Hofte | first3=B | last4=Karabatak | first4=B | last5=Erkelens | first5=C | last6=Stark | first6=L. M. | last7=Flippin | first7=L. A. | last8=Verpoorte | first8=R | doi=10.1248/bpb.27.1804| doi-access=free }} and related plants such as Pancratium maritimum.{{cite journal | doi = 10.1021/jf304586j| pmid = 23331165| title = Ungeremine and Its Hemisynthesized Analogues as Bactericides against Flavobacterium columnare| journal = Journal of Agricultural and Food Chemistry| volume = 61| issue = 6| pages = 1179–83| year = 2013| last1 = Schrader| first1 = Kevin K.| last2 = Avolio| first2 = Fabiana| last3 = Andolfi| first3 = Anna| last4 = Cimmino| first4 = Alessio| last5 = Evidente| first5 = Antonio| bibcode = 2013JAFC...61.1179S}} Pharmacologically, it is of interest as an acetylcholinesterase inhibitor and accordingly as possibly relevant to Alzheimer's disease.{{cite journal | doi = 10.2174/1570159X11311040004| pmid = 24381530| title = Natural AChE Inhibitors from Plants and their Contribution to Alzheimer's Disease Therapy| journal = Current Neuropharmacology| volume = 11| issue = 4| pages = 388–413| year = 2013| last1 = Murray| first1 = Ana| last2 = Faraoni| first2 = Maria| last3 = Castro| first3 = María| last4 = Alza| first4 = Natalia| last5 = Cavallaro| first5 = Valeria| pmc=3744903}} It also has been investigated as a bactericide.