:Validamycin

{{Chembox

| ImageFile = Validamycin.svg

| ImageSize = 200px

| IUPACName = (1R,2R,3S,4S,6R)-2,3-Dihydroxy-6-(hydroxymethyl)-4-{[(1S,4S,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl β-D-glucopyranoside

| SystematicName = (2R,3R,4S,5S,6R)-2-{[(1R,2R,3S,4S,6R)-2,3-Dihydroxy-6-(hydroxymethyl)-4-{[(1S,4S,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol

| OtherNames = Validamycin A; Valimon; Validacin

|Section1={{Chembox Identifiers

| CASNo = 37248-47-8

| CASNo_Ref = {{cascite|correct|}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 313E9620QS

| EC_number = 609-372-4

| PubChem = 443629

| ChemSpiderID = 16736085

| ChEBI = 29703

| ChEMBL = 520780

| KEGG = C12112

| SMILES = OC/C3=C/[C@H](N[C@H]2C[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@H]3O

| InChI = 1/C20H35NO13/c22-3-6-1-8(12(26)15(29)11(6)25)21-9-2-7(4-23)19(17(31)13(9)27)34-20-18(32)16(30)14(28)10(5-24)33-20/h1,7-32H,2-5H2/t7-,8+,9+,10-,11+,12+,13+,14-,15+,16+,17-,18-,19-,20+/m1/s1

| InChIKey = JARYYMUOCXVXNK-IMTORBKUBD

| StdInChI = 1S/C20H35NO13/c22-3-6-1-8(12(26)15(29)11(6)25)21-9-2-7(4-23)19(17(31)13(9)27)34-20-18(32)16(30)14(28)10(5-24)33-20/h1,7-32H,2-5H2/t7-,8+,9+,10-,11+,12+,13+,14-,15+,16+,17-,18-,19-,20+/m1/s1

| StdInChIKey = JARYYMUOCXVXNK-IMTORBKUSA-N

}}

|Section2={{Chembox Properties

| C=20 | H=35 | N=1 | O=13

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Validamycin is an antibiotic and fungicide produced by Streptomyces hygroscopicus. It is used as an inhibitor of trehalase.{{Cite journal

| last1 = Li | first1 = H.

| last2 = Su | first2 = H.

| last3 = Kim | first3 = S. B.

| last4 = Chang | first4 = Y. K.

| last5 = Hong | first5 = S. K.

| last6 = Seo | first6 = Y. G.

| last7 = Kim | first7 = C. J.

| doi = 10.1016/j.jbiosc.2011.09.018

| title = Enhanced production of trehalose in Escherichia coli by homologous expression of otsBA in the presence of the trehalase inhibitor, validamycin A, at high osmolarity

| journal = Journal of Bioscience and Bioengineering

| year = 2011

| pmid = 22036231

| volume=113 | issue=2 | pages=224–32

}} It is used for the control of sheath blight of rice and damping-off of cucumbers.

See also

References