:Valoneic acid

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 445884377

| Name = Valoneic acid

| ImageFile = Valoneic acid.svg

| ImageSize = 200px

| ImageName = Chemical structure of valoneic acid

| ImageAlt = Chemical structure of valoneic acid

| IUPACName =

| OtherNames = Valoneaic acid

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 517-54-4

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G4WG3M7WNB

| PubChem = 12444662

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 26233367

| SMILES = c1c(c(cc(c1O)O)C(=O)O)c2cc(c(cc2C(=O)O)Oc3c(cc(c(c3O)O)O)C(=O)O)O

| InChI = 1/C21H14O13/c22-11-1-6(8(19(28)29)3-12(11)23)7-2-13(24)15(5-9(7)20(30)31)34-18-10(21(32)33)4-14(25)16(26)17(18)27/h1-5,22-27H,(H,28,29)(H,30,31)(H,32,33)

| InChIKey = YIWUPYVTWJLBDH-UHFFFAOYAX

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H14O13/c22-11-1-6(8(19(28)29)3-12(11)23)7-2-13(24)15(5-9(7)20(30)31)34-18-10(21(32)33)4-14(25)16(26)17(18)27/h1-5,22-27H,(H,28,29)(H,30,31)(H,32,33)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YIWUPYVTWJLBDH-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C₂₁H₁₄O₁₃; C₂₁H₁₄O₁₅

| MolarMass = 474.32 g/mol, 506.32 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Valoneic acid is a hydrolysable tannin. It is a component of some hydrolysable tannins such as mallojaponin.

The difference with its isomer sanguisorbic acid is that the hydroxyl that links the hexahydroxydiphenoyl (HHDP) group to the galloyl group belongs to the HHDP group.

File:Valoneic vs sanguisorbic.png

It can be chemically synthesized.Enantioselective synthesis of valoneic acid derivative. Hitoshi Abe, Yusuke Sahara, Yuki Matsuzaki, Yasuo Takeuchi and Takashi Harayama, Tetrahedron Letters, Volume 49, Issue 4, 21 January 2008, pp. 605-609, {{doi|10.1016/j.tetlet.2007.11.154}}