:Vitisin B (stilbenoid)
{{Other uses|Vitisin B (disambiguation){{!}}Vitisin B}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 422979727
| Name = Vitisin B
| ImageFile = Vitisin B (resveratrol tetramer).PNG
| ImageSize = 200px
| ImageName = Chemical structure of vitisin B
| ImageAlt = Chemical structure of vitisin B
| PIN = (22R,23R,32R,33R,4E,62R,63R)-22,32,62-Tris(4-hydroxyphenyl)-22,23,32,33,62,63-hexahydro-2(3,6),3(3,5),6(4,3)-tris([1]benzofurana)-1,7(1)-dibenzenaheptaphan-4-ene-13,15,24,66,73,75-hexol
| OtherNames = R-Viniferin[http://www.actichem.fr/fiches/Resveratrol_2010_Poster.pdf Poster at 1st International Conference of Resveratrol and Health, Jean-Claude Izard, 2010]
|Section1={{Chembox Identifiers
| CASNo =
| CASNo_Ref = {{cascite|correct|??}}=
| ChEBI = 189579
| PubChem = 16133855
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 17290428
| SMILES = c1cc(ccc1[C@H]2[C@@H](c3cc(ccc3O2)/C=C/c4cc(cc5c4[C@H]([C@@H](O5)c6ccc(cc6)O)c7cc(cc(c7)O)O)O)c8cc(c9c(c8)O[C@H]([C@@H]9c1cc(cc(c1)O)O)c1ccc(cc1)O)O)O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C56H42O12/c57-36-10-4-29(5-11-36)54-49(35-23-45(65)53-47(24-35)67-56(31-8-14-38(59)15-9-31)52(53)34-21-41(62)26-42(63)22-34)44-17-28(2-16-46(44)66-54)1-3-32-18-43(64)27-48-50(32)51(33-19-39(60)25-40(61)20-33)55(68-48)30-6-12-37(58)13-7-30/h1-27,49,51-52,54-65H/b3-1+/t49-,51-,52-,54+,55+,56+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = SPRFPODGXUUTIB-APEUUSFDSA-N
| MeSHName =
}}
|Section2={{Chembox Properties
| Formula = C56H42O12
| MolarMass = 906.92 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| GHS_ref =
}}
}}
Vitisin B is a resveratrol tetramer found in plants of the genus Vitis.Opposite Effects of Two Resveratrol (trans-3,5,4′-Trihydroxystilbene) Tetramers, Vitisin A and Hopeaphenol, on Apoptosis of Myocytes Isolated from Adult Rat Heart. Kazuhiko Seya, Kouta Kanemaru, Chiharu Sugimoto, Megumi Suzuki, Teruko Takeo, Shigeru Motomura, Haruo Kitahara, Masatake Niwa, Yoshiteru Oshima and Ken-Ichi Furukawa, JPET January 2009 vol. 328 no. 1 90-98, {{doi|10.1124/jpet.108.143172}}
References
{{reflist}}
External links
- [http://www.chemindustry.com/chemicals/056702389.html Vitisin B on www.chemindustry.com]
- [http://www.biologie.uni-freiburg.de/data/bio2/schroeder/Vitis_vinifera_1995-2008_de.html Website of the Schröder group]
{{Oligostilbenoid}}
Category:Resveratrol oligomers
Category:Natural phenol tetramers
{{aromatic-stub}}