:WAY-213,613

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 451225078

| IUPAC_name = (2S)-2-amino-4-[4-(2-bromo-4,5-difluorophenoxy)anilino]-4-oxobutanoic acid

| image = WAY-213,613_structure.png

| width = 260

| tradename =

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 868359-05-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8QTE6AZR4F

| IUPHAR_ligand = 4531

| PubChem = 11531745

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1628669

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 9706528

| C=16 | H=13 | Br=1 | F=2 | N=2 | O=4

| smiles = C1=CC(=CC=C1NC(=O)C[C@@H](C(=O)O)N)OC2=CC(=C(C=C2Br)F)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H13BrF2N2O4/c17-10-5-11(18)12(19)6-14(10)25-9-3-1-8(2-4-9)21-15(22)7-13(20)16(23)24/h1-6,13H,7,20H2,(H,21,22)(H,23,24)/t13-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BNYDDAAZMBUFRG-ZDUSSCGKSA-N

}}

WAY-213,613 is a drug which acts as a reuptake inhibitor for the glutamate transporter subtype EAAT₂, selective over other glutamate transporter subtypes and highly selective over metabotropic and ionotropic glutamate receptors.{{cite journal | vauthors = Dunlop J, McIlvain HB, Carrick TA, Jow B, Lu Q, Kowal D, Lin S, Greenfield A, Grosanu C, Fan K, Petroski R, Williams J, Foster A, Butera J | display-authors = 6 | title = Characterization of novel aryl-ether, biaryl, and fluorene aspartic acid and diaminopropionic acid analogs as potent inhibitors of the high-affinity glutamate transporter EAAT2 | journal = Molecular Pharmacology | volume = 68 | issue = 4 | pages = 974–82 | date = October 2005 | pmid = 16014807 | doi = 10.1124/mol.105.012005 | s2cid = 24207924 }} It is used in scientific research into the function of the glutamate transporters.{{cite journal | vauthors = Karatas-Wulf U, Koepsell H, Bergert M, Sönnekes S, Kugler P | title = Protein kinase C-dependent trafficking of glutamate transporters excitatory amino acid carrier 1 and glutamate transporter 1b in cultured cerebellar granule cells | journal = Neuroscience | volume = 161 | issue = 3 | pages = 794–805 | date = July 2009 | pmid = 19364521 | doi = 10.1016/j.neuroscience.2009.04.017 | s2cid = 23641405 }}