:WIN-2299

{{Chembox

| ImageFile = WIN-2299.svg

| ImageSize =

| ImageAlt =

| PIN = 2-(Diethylamino)ethyl cyclopentyl(hydroxy)(thiophen-2-yl)acetate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 15421-88-2

| CASNo_Ref = {{cascite|correct|}}

| CASNo1 = 3737-35-7

| CASNo1_Ref = {{cascite|correct|}}

| CASNo1_Comment = (HCl)

| SMILES = O=C(OCCN(CC)CC)C(O)(C1CCCC1)C2=CC=CS2

| EINECS = 239-435-8

| PubChem2 = 160714

| ChemSpiderID = 141215

| InChI = 1/C17H27NO3S/c1-3-18(4-2)11-12-21-16(19)17(20,14-8-5-6-9-14)15-10-7-13-22-15/h7,10,13-14,20H,3-6,8-9,11-12H2,1-2H3

| InChIKey = ASXBIKGZCPZCAN-UHFFFAOYAH

| StdInChI = 1S/C17H27NO3S/c1-3-18(4-2)11-12-21-16(19)17(20,14-8-5-6-9-14)15-10-7-13-22-15/h7,10,13-14,20H,3-6,8-9,11-12H2,1-2H3

| StdInChIKey = ASXBIKGZCPZCAN-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=17 | H=27 | N=1 | O=3 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

WIN-2299 is an anticholinergic drug.{{cite journal | pmid = 13143475 | year = 1954 | last1 = Luduena | first1 = FP | last2 = Lands | first2 = AM | title = An investigation of the pharmacological actions of three potent antispasmodic compounds and their corresponding metho-salts | volume = 110 | issue = 3 | pages = 282–92 | journal = The Journal of Pharmacology and Experimental Therapeutics}} Human reactions to WIN-2299 include sedation (2 mg), LSD-like reactions (6 mg), and an acute delirious episode (10 mg).{{cite journal|pmid=13402982|year=1957|last1=Pennes|first1=HH|last2=Hoch|first2=PH|title=Psychotomimetics, clinical and theoretical considerations: Harmine, Win-2299 and nalline|volume=113|issue=10|pages=887–92|journal=The American Journal of Psychiatry|doi=10.1176/ajp.113.10.887}}