:Xanthomycin A
{{Chembox
| ImageFile = Xanthomycin A Structure.svg
| ImageSize =
| ImageAlt =
| IUPACName =
| OtherNames = Guamecycline; Tetrabiguanide
|Section1={{Chembox Identifiers
| CASNo = 16545-11-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4NQR4R6G3S
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 54688683
| ChemSpiderID = 58190541
| StdInChI = 1S/C29H38N8O8/c1-28(44)13-5-4-6-16(38)17(13)21(39)18-14(28)11-15-20(35(2)3)22(40)19(24(42)29(15,45)23(18)41)25(43)33-12-36-7-9-37(10-8-36)27(32)34-26(30)31/h4-6,14-15,20,38-39,42,44-45H,7-12H2,1-3H3,(H,33,43)(H5,30,31,32,34)/t14-,15-,20-,28+,29-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FAMUIRDLAWWMCQ-AQFAATAFSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| SMILES = C[C@]1(c2cccc(c2C(=C3[C@@H]1C[C@H]4[C@@H](C(=O)C(=C([C@]4(C3=O)O)O)C(=O)NCN5CCN(CC5)C(=N)N=C(N)N)N(C)C)O)O)O
}}
|Section2={{Chembox Properties
| C=29 | H=38 | N=8 | O=8
| Formula =
| MolarMass =
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Xanthomycin A is an antibiotic with in vitro antitumor activity isolated from Streptomyces.{{Cite journal |last=Nishimura T, Kitajima J, Omura S, Tanaka N |date=1981 |title=Antitumor activity of an antibiotic identical with or closely related to xanthomycin A |journal=J Antibiot |volume=34 |issue=7 |pages=856–861 |doi=10.7164/antibiotics.34.856 |pmid=7287588 |doi-access=free}}