:Xanthydrol

{{Short description|Organic compound derived from xanthone reduction}}

{{chembox

| Watchedfields = changed

| verifiedrevid = 430036884

| ImageFile = Xanthydrol.svg

| ImageAlt = Skeletal formula

| ImageFile1 = Xanthydrol-3D-balls.png

| ImageAlt1 = Ball-and-stick model

| PIN = 9H-Xanthen-9-ol

| OtherNames = Xanthanol, 9-Hydroxyxanthene, 9-Xanthydrol, Xanthen-9-ol, 9-Xanthenol, Xanthydrol solution

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo = 90-46-0

| CASNo_Ref = {{cascite|correct|??}}

| Beilstein = 10395

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 65693

| EC_number = 201-996-1

| PubChem = 72861

| RTECS =

| MeSHName =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7131M69IKF

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JFRMYMMIJXLMBB-UHFFFAOYSA-N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C13H10O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13-14H

| SMILES = O2C1=C(C=CC=C1)C(C3=C2C=CC=C3)O

}}

|Section2={{Chembox Properties

| Formula =

| C=13 | H=10 | O=2

| MolarMass =

| Appearance =

| Density =

| MeltingPtC = 124 to 126

| MeltingPt_ref = {{cite journal

| author = Goldberg; Wragg

| year = 1957

| journal = Journal of the Chemical Society

| pages = 4823–4829

| doi = 10.1039/JR9570004823

| title = 972. Spasmolytics derived from xanthen

}}

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb = }}

|Section6={{Chembox Pharmacology

| ATCCode_prefix =

| ATCCode_suffix =

| ATC_Supplemental =

}}

|Section7={{Chembox Hazards

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| Hazards_ref={{cite web |title=9H-Xanthen-9-ol |url=https://pubchem.ncbi.nlm.nih.gov/compound/72861#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| GHSPictograms = {{GHS07}}{{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|315|319|335|411}}

| PPhrases = {{P-phrases|261|264|270|271|273|280|301+312|302+352|304+340|305+351+338|312|321|330|332+313|337+313|362|391|403+233|405|501}}

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL = }}

}}

Xanthydrol is an organic chemical compound. Its formula is C₁₃H₁₀O₂. Its total molecular weight is 198.221 g/mol. Xanthydrol is used to test the levels of urea in the bloodstream.{{cite journal | doi = 10.1111/j.1748-5827.1962.tb04191.x| title = The Estimation of Blood Urea by the Xanthydrol Reaction| journal = Journal of Small Animal Practice| volume = 3| issue = 4| pages = 217–218| year = 1962| last1 = Bowden| first1 = R. S. T.}}