:Y-320
{{Orphan|date=November 2022}}
{{Chembox
| Name = Y-320
| ImageFile = Y-320.svg
| ImageSize = 300px
| ImageAlt =
| PIN = 1-(4-Chlorophenyl)-N-{3-cyano-4-[4-(morpholin-4-yl)piperidin-1-yl]phenyl}-5-methyl-1H-pyrazole-4-carboxamide
| OtherNames = AGN-PC-03MFTL; SureCN6052244; Y-320-5mg; Y-320-10mg; Y-320-25mg; Y-320-50mg; s7516; IL-17 Inhibitor
|Section1={{Chembox Identifiers
| CASNo = 288250-47-5
| PubChem = 22227931
| ChemSpiderID = 11239888
| SMILES = O=C(C1=C(C)N(C2=CC=C(Cl)C=C2)N=C1)NC(C=C3)=CC(C#N)=C3N(CC4)CCC4N5CCOCC5
| InChI = 1S/C27H29ClN6O2/c1-19-25(18-30-34(19)24-5-2-21(28)3-6-24)27(35)31-22-4-7-26(20(16-22)17-29)33-10-8-23(9-11-33)32-12-14-36-15-13-32/h2-7,16,18,23H,8-15H2,1H3,(H,31,35)
| InChIKey = BWZNJVZTAWBIFG-UHFFFAOYSA-N
| StdInChI = 1S/C27H29ClN6O2/c1-19-25(18-30-34(19)24-5-2-21(28)3-6-24)27(35)31-22-4-7-26(20(16-22)17-29)33-10-8-23(9-11-33)32-12-14-36-15-13-32/h2-7,16,18,23H,8-15H2,1H3,(H,31,35)
| StdInChIKey = BWZNJVZTAWBIFG-UHFFFAOYSA-N }}
|Section2={{Chembox Properties
| Formula = C27H29ClN6O2
| MolarMass = 505.01116 g/mol
| Appearance =
| Density = 1.347 g/cm3
| MeltingPt =
| BoilingPtC = 631.225
| BoilingPt_notes = at 760 mmHg
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPtC = 335.553
| AutoignitionPt =
}}
}}
Y-320 is an orally active immunomodulator, and inhibits IL-17 production by CD4 T cells stimulated with IL-15 with IC50 of 20 to 60 nM.{{cite web|title=Selleck Chemicals Y-320, IL-17 Inhibitor|url=http://www.selleckchem.com/products/y-320.html|date=26 Sep 2014}}
Biological activity
=In vitro=
=In vivo=
Y-320 (0.3-3 mg/kg p.o.) ameliorates collagen-induced arthritis (CIA) in mice with a reduction of IL-17 mRNA in arthritic joints, and also shows therapeutic effects on CIA in cynomolgus monkeys. Moreover, Y-320 shows a synergistic effect in combination with anti-TNF-α mAb on chronic-progressing CIA in mice.{{cite journal|title=A new phenylpyrazoleanilide, y-320, inhibits interleukin 17 production and ameliorates collagen-induced arthritis in mice and cynomolgus monkeys. |vauthors=Ushio H, etal |date=2013|journal=Pharmaceuticals|volume=7|issue=1|pages=1–17|doi=10.3390/ph7010001|pmid=24366113|pmc=3915191|doi-access=free }}