Α-Cyclodextrin
{{lowercase title}}
{{Chembox
| ImageFile1 = AlphaCyclodextrin structure.png
| ImageFile2 =
| IUPACName = cyclomaltohexaose
| SystematicName = cyclohexakis-(1→4)-α-D-glucopyranosyl
| OtherNames = Cyclohexaamylose
Cyclohexadextrin
Cyclomaltohexose
α-Cycloamylose
α-Dextrin
|Section1={{Chembox Identifiers
| CASNo = 10016-20-3
| CASNo_Comment = (hydrate)
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEBI = 40585
| ChEMBL = 1230813
| ChemSpiderID = 392705
| DrugBank = DB01909
| EC_number = 233-007-4
| KEGG = D08846
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Z1LH97KTRM
| UNII_Comment = (hydrate)
| PubChem = 444913
| StdInChI=1S/C36H60O30/c37-1-7-25-13(43)19(49)31(55-7)62-26-8(2-38)57-33(21(51)15(26)45)64-28-10(4-40)59-35(23(53)17(28)47)66-30-12(6-42)60-36(24(54)18(30)48)65-29-11(5-41)58-34(22(52)16(29)46)63-27-9(3-39)56-32(61-25)20(50)14(27)44/h7-54H,1-6H2/t7-,8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-/m1/s1
| StdInChIKey = HFHDHCJBZVLPGP-RWMJIURBSA-N
| SMILES = C([C@@H]1[C@@H]2[C@@H]([C@H]([C@H](O1)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]4[C@H](O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]5[C@H](O[C@@H]([C@@H]([C@H]5O)O)O[C@@H]6[C@H](O[C@@H]([C@@H]([C@H]6O)O)O[C@@H]7[C@H](O[C@H](O2)[C@@H]([C@H]7O)O)CO)CO)CO)CO)CO)O)O)O
}}
|Section2={{Chembox Properties
| C=36|H=60|O=30
| MolarMass =
| Appearance = white solid
| Density =
| MeltingPtC = 507
| MeltingPt_notes = at fast heating rates, decomposition below 300 °C for conventional heating {{citation | last = Gatiatulin | first = Askar | title = Determination of Melting Parameters of Cyclodextrins Using Fast Scanning Calorimetry | journal = Int. J. Mol. Sci. | year = 2022 | volume = 23 | issue = 21 | pages = 13120 | doi = 10.3390/ijms232113120| doi-access = free | pmid = 36361919 | pmc = 9655725 }}
| BoilingPt =
| Solubility = 14.5 g/100 mL}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
α-Cyclodextrin (alpha-cyclodextrin), sometimes abbreviated as α-CD, is a hexasaccharide derived from glucose. It is related to the β- (beta) and γ- (gamma) cyclodextrins, which contain seven and eight glucose units, respectively. All cyclodextrins are white, water-soluble solids with minimal toxicity. Cyclodextrins tend to bind other molecules in their quasi-cylindrical, lipophilic interiors. The compound is of wide interest because it exhibits host–guest properties, forming inclusion compounds.{{cite journal|journal=Chemical Society Reviews|title=Surveying macrocyclic chemistry: from flexible crown ethers to rigid cyclophanes|author1=Zhichang Liu |author2=Siva Krishna Mohan Nalluria |author3=J. Fraser Stoddart|volume=46|issue=9|pages=2367–2650|year=2017|doi=10.1039/c7cs00185a|pmid=28462968}} This inclusion (and release) behavior leads to applications in medicine.{{cite journal|title=Introduction and General Overview of Cyclodextrin Chemistry|author=József Szejtli|journal=Chem. Rev.|year=1998|volume=98|issue=5|pages=1743–1754|doi=10.1021/cr970022c|pmid=11848947}}
Structure
{{main|cyclodextrin#Structure}}
In α-cyclodextrin, the six glucose subunits are linked end to end via α-1, 4 linkages. The result has the shape of a tapered cylinder, with six primary alcohols on one face and twelve secondary alcohol groups on the other. The exterior surface of cyclodextrins is somewhat hydrophilic whereas the interior core is hydrophobic.
Applications
α-Cyclodextrin is marketed for a range of medical, healthcare, and food and beverage applications. For drug delivery, this cyclodextrin confers aqueous solubility to hydrophobic drugs and stability to labile drugs.{{cite encyclopedia|author1=Thomas Wimmer|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|publisher=Wiley-VCH|year=2012|doi=10.1002/14356007.e08_e02|isbn = 978-3-527-30673-2|chapter = Cyclodextrins}}
Image:Rotaxane Crystal Structure ChemComm page493 2001 commons.jpg with an α-cyclodextrin macrocycle.{{cite journal |doi=10.1039/b010015n |title=Synthesis of fluorescent stilbene and tolan rotaxanes by Suzuki coupling |year=2001 |last1=Stanier |first1=Carol A. |last2=O'Connell |first2=Michael J. |last3=Anderson |first3=Harry L. |last4=Clegg |first4=William |journal=Chemical Communications |issue=5 |pages=493–494}}]]
Synthesis
Cyclodextrins are natural starch-conversion products. For industrial use, they are manufactured by enzymatic degradation from vegetable raw materials, such as corn or potatoes. First, the starch is liquified either by heat treatment or using α-amylase. Then cyclodextrin glycosyltransferase (CGTase) is added for enzymatic conversion. CGTases produce diverse cyclodextrins. The selectivity of the synthesis can be improved by the addition of specific guests.