Δ-Carotene

{{lowercasetitle}}

{{Chembox

| ImageFile = Delta-carotene.svg

| ImageSize = 300

| ImageAlt = Skeletal formula

| ImageFile1 = Delta-Carotene-3D-spacefill.png

| ImageSize1 = 300

| ImageAlt1 = Space-filling model

| Name=δ-Carotene

| IUPACName = ε,ψ-Carotene

| SystematicName = (6R)-6-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-3,7,12,16,20,24-Hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,23-undecaen-1-yl]-1,5,5-trimethylcyclohex-1-ene

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID = 4444642

| InChI = 1S/C40H56/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-

12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h11-12,14-16,

18-20,22-30,39H,13,17,21,31H2,1-10H3/b12-11+,22-14+,23-16+,26-15+,

30-29+,33-19+,34-20+,35-24+,36-25+,37-27+/t39-/m0/s1

| InChIKey = WGIYGODPCLMGQH-GOXCNPTKSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 472-92-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZVE2M2UXOD

| PubChem=5281230

| SMILES = CC1=CCCC(C1C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)(C)C

}}

|Section2={{Chembox Properties

| Formula=C₄₀H₅₆

| MolarMass=536.873

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

δ-Carotene (delta-carotene) or ε,ψ-carotene is a form of carotene with an ε-ring at one end, and the other uncyclized, labelled ψ (psi). It is an intermediate synthesis product in some photosynthetic plants between lycopene and α-carotene (β,ε-carotene) or ε-carotene (ε,ε-carotene).{{cite journal | vauthors = Cunningham FX, Gantt E | title = One ring or two? Determination of ring number in carotenoids by lycopene epsilon-cyclases | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 98 | issue = 5 | pages = 2905–10 | date = February 2001 | pmid = 11226339 | pmc = 30238 | doi = 10.1073/pnas.051618398 | doi-access = free }} δ-Carotene is fat soluble. Delta-carotene contains an alpha-ionone instead of a beta-ionone ring;{{cite journal | vauthors = Tomes ML | title = Delta-carotene in the tomato | journal = Genetics | volume = 62 | issue = 4 | pages = 769–80 | date = August 1969 | doi = 10.1093/genetics/62.4.769 | pmid = 17248458 | pmc = 1212314 }} this conversion is carried out by the gene Del which shifts the position of the double bond in the ring structure. The formation delta-carotene under the presence of the Del gene is sensitive to high temperatures.{{cite journal | vauthors = Tomes ML | title = The competitive effect of the Beta- and delta-carotene genes on alpha- or Beta-ionone ring formation in the tomato | journal = Genetics | volume = 56 | issue = 2 | pages = 227–32 | date = June 1967 | doi = 10.1093/genetics/56.2.227 | pmid = 17248383 | pmc = 1211498 }}