α-Pyrrolidinoheptaphenone

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{DISPLAYTITLE:α-Pyrrolidinoheptaphenone}}

{{Infobox drug

| drug_name = α-Pyrrolidinoheptaphenone

| INN =

| type =

| IUPAC_name = 1-Phenyl-2-pyrrolidin-1-ylheptan-1-one

| image = Alpha-Pyrrolidinoheptaphenone.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA = Schedule I

| legal_NZ =

| legal_DE = NpSG

| legal_UK = Class B

| legal_US = Schedule I

| legal_UN =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 13415-83-3

| CAS_supplemental =
13415-55-9 (HCl)
2304915-38-4 (R)
2304915-72-6 (S)

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| PubChem = 69245534

| DrugBank =

| UNII = E6220IS097

| ChemSpiderID = 57379805

| synonyms = α-PHPP; alpha-PHPP; alpha-Pyrrolidinoheptiophenone; alpha-Pyrrolidinoheptanophenone; PV-8; PV8; Aphpp; A-PHPP

| C=17|H=25|N=1|O=1

| StdInChI=1S/C17H25NO/c1-2-3-5-12-16(18-13-8-9-14-18)17(19)15-10-6-4-7-11-15/h4,6-7,10-11,16H,2-3,5,8-9,12-14H2,1H3

| StdInChIKey = DLRWKNLMJAIFQB-UHFFFAOYSA-N

| smiles = CCCCCC(C(=O)C1=CC=CC=C1)N2CCCC2

}}

α-Pyrrolidinoheptaphenone (PV8, α-PEP, α-PHPP, Aphpp, A-PHPP) is a designer drug of the pyrrolidinophenone class of cathinones.{{Cite journal | doi = 10.1007/s11419-014-0248-3 | title = Determination of new pyrrolidino cathinone derivatives, PVT, F-PVP, MPHP, PV8, PV9 and F-PV9, in human blood by MALDI-Q-TOF mass spectrometry | journal = Forensic Toxicology | volume = 33 | pages = 148–154 | year = 2015 | vauthors = Minakata K, Yamagishi I, Nozawa H, Hasegawa K, Wurita A, Gonmori K, Suzuki M, Watanabe K, Suzuki O | doi-access = | s2cid = 8271553 }}{{cite journal | vauthors = Uchiyama N, Matsuda S, Kawamura M, Shimokawa Y, Kikura-Hanajiri R, Aritake K, Urade Y, Goda Y | title = Characterization of four new designer drugs, 5-chloro-NNEI, NNEI indazole analog, α-PHPP and α-POP, with 11 newly distributed designer drugs in illegal products | journal = Forensic Science International | volume = 243 | pages = 1–13 | date = October 2014 | pmid = 24769262 | doi = 10.1016/j.forsciint.2014.03.013 }} It is the higher homolog of α-pyrrolidinohexiophenone (α-PHP).

In the United States, α-pyrrolidinoheptaphenone is a Schedule I Controlled Substance.{{cite web | title = Schedules of Controlled Substances: Temporary Placement of N-Ethylhexedrone, α-PHP, 4-MEAP, MPHP, PV8, and 4-Chloro-α-PVP in Schedule I | url = https://www.deadiversion.usdoj.gov/fed_regs/rules/2019/fr0501.htm | publisher = Drug Enforcement Administration | access-date = 2019-07-30 | archive-date = 2021-04-30 | archive-url = https://web.archive.org/web/20210430020931/https://www.deadiversion.usdoj.gov/fed_regs/rules/2019/fr0501.htm | url-status = dead }}