β-Eleostearic acid
{{lowercasetitle}}
{{Chembox
| Watchedfields = changed
| verifiedrevid = 443421231
| Name = β-Eleostearic acid
| ImageFile = beta-Eleostearic acid.svg
| ImageSize = 250px
| PIN = (9E,11E,13E)-Octadeca-9,11,13-trienoic acid
| OtherNames = (E,E,E)-9,11,13-Octadecatrienoic acid
|Section1={{Chembox Identifiers
| CASNo = 544-73-0
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = LA17B88161
| PubChem = 5282820
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445947
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 38384
| SMILES = O=C(O)CCCCCCC\C=C\C=C\C=C\CCCC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5+,8-7+,10-9+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CUXYLFPMQMFGPL-SUTYWZMXSA-N
}}
|Section2={{Chembox Properties
| C=18 | H=30 | O=2
| Appearance =
| Density =
| MeltingPtC = 71.5
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
β-Eleostearic acid, or (9E,11E,13E)-octadeca-9,11,13-trienoic acid, is an organic compound with formula {{chem|C|18|H|30|O|2}} or H3C(CH2)3(CH=CH)3(CH2)7COOH. It is an all-trans isomer of octadecatrienoic acid.
See also
- α-Eleostearic acid, the (9Z,11E,13E)-isomer, found in tung oil and bitter gourd seed oil.
{{Fatty acids}}
{{DEFAULTSORT:Eleostearic acid, beta-}}
{{Organic-compound-stub}}