1,2-Bis(dichlorophosphino)ethane

{{Chembox

| ImageFile = C2H4(PCl2)2.svg

| ImageSize = 148

| ImageAlt =

| PIN = (Ethane-1,2-diyl)bis(phosphonous dichloride)

| OtherNames = 1,2-Ethanebis(phosphonous dichloride)

|Section1={{Chembox Identifiers

| CASNo = 28240-69-9

| PubChem = 119904

| DTXSID = DTXSID3067368

| ChemSpiderID = 107057

| StdInChI=1S/C2H4Cl4P2/c3-7(4)1-2-8(5)6/h1-2H2

| StdInChIKey = SBWAJHLQMFBNIN-UHFFFAOYSA-N

| SMILES = C(CP(Cl)Cl)P(Cl)Cl

}}

|Section2={{Chembox Properties

| C=2|H=4|P=2|Cl=4

| MolarMass =

| Appearance = colorless liquid

| Density =

| MeltingPt =

| BoilingPtC = 68

| BoilingPt_notes = 1 mmHg

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS05}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|314}}

| PPhrases = {{P-phrases|260|264|280|301+330+331|303+361+353|304+340|305+351+338|310|321|363|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

1,2-Bis(dichlorophosphino)ethane is an organophosphorus compound with the formula (CH2PCl2)2. This colorless liquid is a precursor to chelating diphosphines.

Synthesis and reactions

It is prepared by the reaction of ethylene, white phosphorus, and phosphorus trichloride:{{cite journal|doi=10.1016/S0022-328X(00)94383-3|title=A convenient synthesis of 1,2-bis(dichlorophosphino)ethane, 1,2-bis(dimethylphosphino)ethane and 1,2-bis(diethylphosphino)ethane|journal=Journal of Organometallic Chemistry|volume=182|pages=203–206|year=1979|last1=Burt|first1=Roger J.|last2=Chatt|first2=Joseph|last3=Hussain|first3=Wasif|last4=Leigh|first4=G.Jeffery|issue=2 }}

:3 C2H4 + 0.5 P4 + 4 PCl3 → 3 (CH2PCl2)2

The compound reacts with Grignard reagents and secondary amines to give chelating ligands.{{cite journal|doi=10.1021/ja00134a014|title=N-Pyrrolyl Phosphines: An Unexploited Class of Phosphine Ligands with Exceptional .pi.-Acceptor Character|journal=Journal of the American Chemical Society|volume=117|pages=7696–7710|year=1995|last1=Moloy|first1=Kenneth G.|last2=Petersen|first2=Jeffrey L.|issue=29 }} An often practiced use of this compound is the synthesis of 1,2-bis(dimethylphosphino)ethane.

Related compounds

References

{{Reflist}}

{{DEFAULTSORT:Bis(dichlorophosphino)ethane, 1,2-}}

Category:Phosphines

Category:1,2-Ethanediyl compounds