1,2-Dibromobenzene

{{Chembox

| ImageFile = 1,2-dibromobenzene_200.svg

| ImageSize = 144px

| ImageAlt =

| PIN = 1,2-Dibromobenzene

| OtherNames = o-Dibromobenzene

|Section1={{Chembox Identifiers

| CASNo = 583-53-9

| PubChem = 11414

| ChEBI = 37152

| ChEMBL = 1797135

| EC_number = 209-507-3

| ChemSpiderID = 13875212

| Gmelin = 130950

| Beilstein = 970241

| UNNumber = 2711

| UNII = 52K9W7U6EH

| DTXSID = DTXSID0022064

| StdInChI=1S/C6H4Br2/c7-5-3-1-2-4-6(5)8/h1-4H

| StdInChIKey = WQONPSCCEXUXTQ-UHFFFAOYSA-N

| SMILES = C1=CC=C(C(=C1)Br)Br

}}

|Section2={{Chembox Properties

| C=6|H=4|Br=2

| MolarMass =

| Appearance = colorless liquid

| Density = 1.9940 g/cm³

| MeltingPtC = 7.1

| BoilingPtC = 225

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

| Section4 = {{Chembox Related

| OtherCompounds = {{ubl|1,3-Dibromobenzene|1,4-Dibromobenzene|1,2-Dichlorobenzene}}

}}

}}

1,2-Dibromobenzene (o-dibromobenzene) is an aryl bromide and isomer of dibromobenzene. It is one of three isomers, the others being 1,3- and 1,4-dibromobenzene. It is a colorless liquid, although impure samples appear yellowish. The compound is a precursor to many 1,2-disubstituted derivatives of benzene. For example, it is a precursor to 1,2-dicyanobenzene{{Ullmann|author=Löbbert, Gerd|title=Phthalocyanines|year=2000|doi=10.1002/14356007.a20_213}} and dithioethers.{{cite journal |doi=10.15227/orgsyn.042.0022|title=1,2-bis(n-Butylthio)benzene|journal=Organic Syntheses|year=1962|volume=42|page=22|first1=Roger|last1= Adams|first2=Walter| last2=Reifschneider|first3=Aldo|last3=Ferretti

}}