1,2-Dinitrobenzene

{{Chembox

| ImageFile1 = O-Dinitrobenzol.svg

| ImageSize1 = 100

| ImageAlt1 =

| ImageFileL2 = 1,2-dinitrobenzene-from-xtal-view-2-3D-bs-17.png

| ImageFileR2 = 1,2-dinitrobenzene-from-xtal-view-2-3D-sf.png

| PIN = 1,2-Dinitrobenzene

| OtherNames = ortho-dinitrobenzene

|Section1={{Chembox Identifiers

| CASNo = 528-29-0

| PubChem = 10707

| EC_number = 208-431-8

| RTECS = CZ7450000

| UNNumber = 3443 1597

| UNII = 35XUO924Y0

| ChemSpiderID = 10257

| ChEMBL = 168075

| StdInChI=1S/C6H4N2O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H

| StdInChIKey = IZUKQUVSCNEFMJ-UHFFFAOYSA-N

| SMILES = C1=CC=C(C(=C1)[N+](=O)[O-])[N+](=O)[O-]

}}

|Section2={{Chembox Properties

| C=6|H=4|N=2|O=4

| MolarMass =

| Appearance = white solid

| Density = 1.565 g/cm³

| MeltingPtC = 118

| BoilingPtC = 318

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHSPictograms = {{GHS06}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|300|310|330|373|410}}

| PPhrases = {{P-phrases|260|262|264|270|271|273|280|284|301+310|302+350|304+340|310|314|320|321|322|330|361|363|391|403+233|405|501}}

}}

}}

1,2-Dinitrobenzene is one of three isomers of dinitrobenzene, with the formula C₆H₄(NO₂)₂. The compound is a white or colorless solid that is soluble in organic solvents. It is prepared from 2-nitroaniline by diazotization and treatment with sodium nitrite in the presence of a copper catalyst.{{cite journal|author=E. B. Starkey|title=p-Dinitrobenzene|journal=Org. Synth.|year=1939|volume=19|page=40|doi=10.15227/orgsyn.019.0040}}