1,3-Dichloropropan-2-ol

{{Chembox

| ImageFile = 1,3-Dichloropropan-2-ol.svg

| ImageSize = 150px

| ImageAlt =

| PIN = 1,3-Dichloropropan-2-ol

| OtherNames =1,3-Dichloropropanol-2; 1,3-Dichloroisopropyl alcohol; 1,3-Dichloro-2-propanol; 1,3-Dichloroisopropanol; Glycerol-α,γ-dichlorohydrin; α-Dichlorohydrin; 1,3-DCP; DC2P

| Section1 = {{Chembox Identifiers

| CASNo = 96-23-1

| PubChem = 7289

| EC_number = 202-491-9

| RTECS = UB1400000

| UNNumber = 2750

| ChEBI = 18917

| ChEMBL = 468581

| KEGG = C14399

| ChemSpiderID = 21106535

| SMILES = C(C(CCl)O)Cl

| UNII = 0F4P2VQC07

| InChI=1S/C3H6Cl2O/c4-1-3(6)2-5/h3,6H,1-2H2

| InChIKey=DEWLEGDTCGBNGU-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=3|H=6|Cl=2|O=1

| Appearance = Colorless liquid{{GESTIS|ZVG=32050}}

| Odor = Phenol-like

| Density = 1.39 g/cm³ (20 °C)

| MeltingPtC = -4

| MeltingPt_ref =

| BoilingPtC = 175

| BoilingPt_ref =

| Solubility = 110 g/L (20 °C)

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPtC = 74

| FlashPt_ref =

| AutoignitionPt =

| LD50 = 110 mg/kg (oral, rat)
1080 mg/kg (dermal, rabbit)

| GHSPictograms = {{GHS06}}{{GHS07}}{{GHS08}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|301|311|312|336|350|370|373}}

| PPhrases = {{P-phrases|201|202|260|261|264|270|271|280|281|301+310|302+352|304+340|307+311|308+313|312|314|321|322|330|361|363|403+233|405|501}}

}}

}}

1,3-Dichloropropan-2-ol (1,3-DCP) is an organic compound with the formula HOCH₂CHClCH₂Cl. It is a colorless liquid. It is an intermediate in the production of epichlorohydrin.{{cite book | url = https://www.ncbi.nlm.nih.gov/books/NBK373196/ | title = Some Chemicals Present in Industrial and Consumer Products, Food and Drinking-Water | chapter = 1,3-Dichloro-2-propanol | year = 2013 | publisher = International Agency for Research on Cancer }}{{cite journal|doi=10.1021/es903383a|pmid=20163179|title=Identifying New Persistent and Bioaccumulative Organics Among Chemicals in Commerce|journal=Environmental Science & Technology|volume=44|issue=7|pages=2277–2285|year=2010|last1=Howard|first1=Philip H.|last2=Muir|first2=Derek C. G.|bibcode=2010EnST...44.2277H|doi-access=free}}

1,3-DCP is a believed to be a carcinogen and mutagen.{{Cite web | url = https://oehha.ca.gov/media/downloads/proposition-65/13-dcphida.pdf | title = Evidence on the Carcinogenicity of 1,3-Dichloro-2-Propanol (1,3-DCP; α,γ-Dichlorohydrin) | publisher = Reproductive and Cancer Hazard Assessment Branch Office of Environmental Health Hazard Assessment, California Environmental Protection Agency | date = June 2010}} The International Agency for Research on Cancer classifies it as a Group 2B carcinogen ("possibly carcinogenic to humans").{{Cite web | url = http://monographs.iarc.fr/ENG/Classification/latest_classif.php | title = List of Classifications | publisher = International Agency for Research on Cancer}}

Along with 3-monochloropropane-1,2-diol (3-MCPD), 1,3-DCP is found in some Asian style sauces such as soy sauce and oyster sauce.{{Cite journal | doi = 10.1021/acs.jafc.6b05051| pmid = 28064506| title = Simultaneous Analysis of 3-MCPD and 1,3-DCP in Asian Style Sauces Using QuEChERS Extraction and Gas Chromatography–Triple Quadrupole Mass Spectrometry| journal = Journal of Agricultural and Food Chemistry| volume = 65| issue = 4| pages = 981–985| year = 2017| last1 = Genualdi| first1 = Susan| last2 = Nyman| first2 = Patricia| last3 = Dejager| first3 = Lowri| pmc = 5450852}}{{Cite journal | doi = 10.1080/02652030110098580| pmid = 11962691| title = Determination of 1,3-dichloropropanol in soy sauces by automated headspace gas chromatography-mass spectrometry| journal = Food Additives and Contaminants| volume = 19| issue = 4| pages = 343–349| year = 2002| last1 = Crews| first1 = C| last2 = Lebrun| first2 = G| last3 = Brereton| first3 = P. A| s2cid = 28748623}}{{Cite journal| doi = 10.1111/1541-4337.12120| title = 3-Chloropropane-1,2-diol (3-MCPD) in Soy Sauce: A Review on the Formation, Reduction, and Detection of This Potential Carcinogen| journal = Comprehensive Reviews in Food Science and Food Safety| volume = 14| pages = 48–66| year = 2015| last1 = Lee| first1 = Bai Qin| last2 = Khor| first2 = Sook Mei| issue = 1| pmid = 33401813| url = https://figshare.com/articles/journal_contribution/2063397/1/files/3666990.pdf}}