1,4-Dinitrobenzene

{{Chembox

| ImageFile1 = P-Dinitrobenzol.svg

| ImageSize1 = 52

| ImageAlt1 =

| ImageFileL2 = 1,4-dinitrobenzene-from-xtal-view-2-3D-bs-17.png

| ImageFileR2 = 1,4-dinitrobenzene-from-xtal-view-2-3D-sf.png

| PIN = 1,4-Dinitrobenzene

| OtherNames = para-dinitrobenzene

|Section1={{Chembox Identifiers

| CASNo = 100-25-4

| PubChem = 7492

| ChemSpiderID = 7211

| EC_number = 202-833-7

| RTECS = CZ7525000

| UNNumber = 3443 1597

| UNII = 784Q9O56S9

| Beilstein = 1105828

| StdInChI=1S/C6H4N2O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H

| StdInChIKey = FYFDQJRXFWGIBS-UHFFFAOYSA-N

| SMILES = C1=CC(=CC=C1[N+](=O)[O-])[N+](=O)[O-]

}}

|Section2={{Chembox Properties

| C=6|H=4|N=2|O=4

| MolarMass =

| Appearance = pale yellow solid

| Density = 1.625 g/cm³

| MeltingPtC = 173

| BoilingPtC = 299

| Solubility = 69 mg/L}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPtC = 150

| AutoignitionPt =

| GHSPictograms = {{GHS06}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|300|310|330|373|410}}

| PPhrases = {{P-phrases|260|262|264|270|271|273|280|284|301+310|302+350|304+340|310|314|320|321|322|330|361|363|391|403+233|405|501}}

}}

}}

1,4-Dinitrobenzene is one of three isomers of dinitrobenzene, with the formula C₆H₄(NO₂)₂. The 1,4-isomer is most symmetrical. The compound is a yellow solid that is soluble in organic solvents. It is prepared from 4-nitroaniline by diazotization followed by treatment with sodium nitrite in the presence of a copper catalyst.{{cite journal|author=E. B. Starkey|title=p-Dinitrobenzene|journal=Org. Synth.|year=1939|volume=19|page=40|doi=10.15227/orgsyn.019.0040}}