1-Androstenediol

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (3R,5S,8R,9S,10R,13S,14S,17S)-10,13-Dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-3,17-diol

| image = 1-Androstenediol.svg

| image_class = skin-invert-image

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 5323-27-3

| CAS_supplemental =

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| PubChem = 11300765

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank = DB01503

| ChemSpiderID_Ref =

| ChemSpiderID = 9475742

| UNII = V7W74907I7

| KEGG =

| ChEBI =

| ChEMBL =

| C=19 | H=30 | O=2

| smiles = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CC[C@@H]4[C@@]3(C=C[C@@H](C4)O)C

| StdInChI_Ref =

| StdInChI = 1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,12-17,20-21H,3-6,8,10-11H2,1-2H3/t12-,13-,14-,15-,16-,17-,18-,19-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = RZFGPAMUAXASRE-YSZCXEEOSA-N

| synonyms =

}}

1-Androstenediol, or 5α-androst-1-ene-3β,17β-diol, also known as 4,5α-dihydro-δ{{sup|1}}-4-androstenediol, is a prohormone of 1-testosterone (Δ{{sup|1}}-{{abbr|DHT|dihydrotestosterone}}).{{cite book| vauthors = Schnäuzer W, Thevis M | chapter = Detecting Illegal Use of Androgens and SARMs | veditors = Nieschlag E, Behre HM, Nieschlag S |title=Testosterone: Action, Deficiency, Substitution| chapter-url = https://books.google.com/books?id=MkrAPaQ4wJkC&pg=PA521 |date=26 July 2012|publisher=Cambridge University Press|isbn=978-1-107-01290-5|pages=521–}}{{cite book| vauthors = Llewellyn W |title=Anabolics|url=https://books.google.com/books?id=afKLA-6wW0oC&pg=PT300|year=2011|publisher=Molecular Nutrition Llc|isbn=978-0-9828280-1-4|pages=300–}} It has been used as a dietary supplement, and is identified by the World Anti-Doping Agency as a prohibited substance related to anabolic steroids.{{cite journal | vauthors = Parr MK, Opfermann G, Geyer H, Westphal F, Sönnichsen FD, Zapp J, Kwiatkowska D, Schänzer W | title = Seized designer supplement named "1-Androsterone": identification as 3β-hydroxy-5α-androst-1-en-17-one and its urinary elimination | journal = Steroids | volume = 76 | issue = 6 | pages = 540–547 | date = May 2011 | pmid = 21310167 | doi = 10.1016/j.steroids.2011.02.001 }}