1-Androsterone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (3R,5S,8R,9S,10R,13S,14S)-3-Hydroxy-10,13-dimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one

| image = 1-Androsterone.svg

| width = 225px

| image2 = 1-DHEA.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 23633-63-8

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 67430008

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 48063738

| UNII = U5M72D8OWZ

| KEGG =

| ChEBI =

| ChEMBL =

| C = 19

| H = 28

| O = 2

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC[C@@H]4[C@@]3(C=C[C@@H](C4)O)C

| StdInChI_Ref =

| StdInChI = 1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,12-16,20H,3-6,8,10-11H2,1-2H3/t12-,13-,14-,15-,16-,18-,19-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = DYMROBVXGSLPAY-LUJOEAJASA-N

| synonyms = 1-Andro; 1-Dehydroepiandrosterone; 1-DHEA; δ¹-Epiandrosterone; 1-Prasterone; 5α-Androst-1-en-3β-ol-17-one

}}

1-Androsterone (also known as 1-andro, 1-dehydroepiandrosterone, 1-DHEA, δ¹-epiandrosterone, or 5α-androst-1-en-3β-ol-17-one) is a synthetic, orally active anabolic-androgenic steroid (AAS).{{cite journal | vauthors = Parr MK, Opfermann G, Geyer H, Westphal F, Sönnichsen FD, Zapp J, Kwiatkowska D, Schänzer W | title = Seized designer supplement named "1-Androsterone": identification as 3β-hydroxy-5α-androst-1-en-17-one and its urinary elimination | journal = Steroids | volume = 76 | issue = 6 | pages = 540–7 | year = 2011 | pmid = 21310167 | doi = 10.1016/j.steroids.2011.02.001 | s2cid = 4942690 }} It is an androgen prohormone of 1-testosterone (dihydroboldenone), 1-androstenedione, and other 1-dehydrogenated androstanes. The drug has been sold on the Internet as a designer steroid and "dietary supplement". It is a positional isomer of dehydroepiandrosterone (DHEA; 5-dehydroepiandrosterone).