1-Boc-4-AP

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = tert-butyl 4-anilinopiperidine-1-carboxylate

| image = 1-Boc-4-AP_structure.png

| image_class = skin-invert

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_DE =

| legal_UK =

| legal_US = List 1

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 125541-22-2

| UNII = 5PB6P54SRS

| ATC_prefix =

| ATC_suffix =

| PubChem = 1491502

| ChemSpiderID = 1231607

| ChEMBL = 1574621

| smiles = CC(C)(C)OC(=O)N1CCC(CC1)NC2=CC=CC=C2

| StdInChI = 1S/C16H24N2O2/c1-16(2,3)20-15(19)18-11-9-14(10-12-18)17-13-7-5-4-6-8-13/h4-8,14,17H,9-12H2,1-3H3

| StdInChIKey = HTIWISWAPVQGMI-UHFFFAOYSA-N

| C=16 | H=24 | N=2 | O=2

}}

[https://www.lifechempharma.com/product/1-boc-piperazine/ 1-Boc-4-AP (tert-butyl 4-(phenylamino)piperidine-1-carboxylate]) is a compound used as an intermediate in the manufacture of fentanyl, as well as various related derivatives such as butyrylfentanyl, furanylfentanyl, benzylfentanyl and homofentanyl, among others. It is an N-protected derivative of 4-anilinopiperidine which can be readily converted to fentanyl or related analogues in several straightforward synthetic steps. It was classified as a DEA List 1 Chemical in 2022, and is also controlled in various other jurisdictions. Its possession, sale and importation are consequently heavily regulated throughout much of the world.{{cite web | url = https://www.federalregister.gov/documents/2022/11/09/2022-24155/specific-listing-for-1-boc-4-ap-a-currently-controlled-list-i-chemical | title = Specific Listing for 1-boc-4-AP, a Currently Controlled List I Chemical. | work = Federal Register, 87 FR 67550-67553 | date = 9 November 2022 }} 1-Boc-4-AP has also been identified as an impurity in other designer drug products, though it is unclear if it has any pharmacological activity in its own right.{{cite journal | vauthors = May C, Downey C, Power JD, Kavanagh PV | title = An unusual detection of tert-butyl-4-anilinopiperidine-1-carboxylate in seizures of falsified 'Xanax' tablets and in items in a suspected heroin seizure submitted by Irish law enforcement | journal = Drug Testing and Analysis | volume = 12 | issue = 9 | pages = 1387–1392 | date = September 2020 | pmid = 32567251 | doi = 10.1002/dta.2884 | s2cid = 219974817 }}