1-Deoxy-D-xylulose 5-phosphate

{{DISPLAYTITLE:1-Deoxy-D-xylulose 5-phosphate}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{chembox

| Verifiedfields = changed

| verifiedrevid = 477199225

| Name=1-Deoxy-{{sm|d}}-xylulose 5-phosphate

| ImageFile=DOXP.png

| ImageSize=

| IUPACName=(2,3-dihydroxy-4-oxopentyl) dihydrogen phosphate

| OtherNames=DOXP

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16493

| ChemSpiderID = 391473

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C11437

| InChI = 1/C5H11O7P/c1-3(6)5(8)4(7)2-12-13(9,10)11/h4-5,7-8H,2H2,1H3,(H2,9,10,11)/t4-,5-/m1/s1

| InChIKey = AJPADPZSRRUGHI-RFZPGFLSBQ

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C5H11O7P/c1-3(6)5(8)4(7)2-12-13(9,10)11/h4-5,7-8H,2H2,1H3,(H2,9,10,11)/t4-,5-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AJPADPZSRRUGHI-RFZPGFLSSA-N

| CASNo=190079-18-6

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = I4C288B3TN

| PubChem=443201

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB02496

| SMILES = O=P(O)(O)OC[C@@H](O)[C@H](O)C(=O)C

| MeSHName=1-deoxy-D-xylulose+5-phosphate

}}

|Section2={{Chembox Properties

| Formula=C5H11O7P

| MolarMass=214.11

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

1-Deoxy-{{sm|d}}-xylulose 5-phosphate is a biosynthetic intermediate in the non-mevalonate pathway.

Function

The enzyme involved in making 1-deoxy-d-xylulose 5-phosphate (DXP) is DXP synthase.{{Cite journal |last1=Xiang |first1=Song |last2=Usunow |first2=Gerlinde |last3=Lange |first3=Gudrun |last4=Busch |first4=Marco |last5=Tong |first5=Liang |date=January 2007 |title=Crystal Structure of 1-Deoxy-d-xylulose 5-Phosphate Synthase, a Crucial Enzyme for Isoprenoids Biosynthesis |journal=Journal of Biological Chemistry |language=en |volume=282 |issue=4 |pages=2676–2682 |doi=10.1074/jbc.M610235200|doi-access=free }} The mechanism follows a catalysis of decarboxylative condensation of pyruvate and d-glyceraldehyde 3-phosphate to produce DXP.{{Cite journal |last1=Bartee |first1=David |last2=Freel Meyers |first2=Caren L. |date=2018-07-24 |title=Targeting the Unique Mechanism of Bacterial 1-Deoxy- d -xylulose-5-phosphate Synthase |journal=Biochemistry |language=en |volume=57 |issue=29 |pages=4349–4356 |doi=10.1021/acs.biochem.8b00548 |pmid=29944345 |pmc=6057799 |issn=0006-2960}} In addition, the molecule is involved in making thiamine (vitamin B1) and pyridoxol (vitamin B6).

The non-mevalonate pathway intermediate 1-deoxy-d-xylulose 5-phosphate (DXP) also acts as a precursor in making isoprenoids in many species such as bacteria, plants, and apicomplexan parasites, contributing to biological diversity.{{cite journal | vauthors = Bartee D, Freel Meyers CL | title = Toward Understanding the Chemistry and Biology of 1-Deoxy-d-xylulose 5-Phosphate (DXP) Synthase: A Unique Antimicrobial Target at the Heart of Bacterial Metabolism | journal = Accounts of Chemical Research | volume = 51 | issue = 10 | pages = 2546–2555 | date = October 2018 | pmid = 30203647 | pmc = 6309272 | doi = 10.1021/acs.accounts.8b00321 }}

See also

References

{{Reflist}}

{{Cholesterol metabolism intermediates}}

{{DEFAULTSORT:Deoxy-D-xylulose 5-phosphate, 1-}}

Category:Monosaccharide derivatives

Category:Organophosphates